glufosfamide
{{Chembox
| ImageFile = Glufosfamide structure.svg
| ImageSize = 175
| ImageAlt = Glufosfamide chemical structure
| IUPACName = β-D-Glucopyranosyl N,N′-bis(2-chloroethyl)phosphorodiamidate
| SystematicName = (2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl N,N′-bis(2-chloroethyl)phosphorodiamidate
| OtherNames = β-D-glucosylisophosphoramide mustard
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 132682-98-5
| PubChem = 123628
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1W5N8SZD9A
| ChEMBL = 2107143
| ChemSpiderID = 110215
| SMILES = O[C@H]1[C@H](OP(NCCCl)(NCCCl)=O)O[C@H](CO)[C@@H](O)[C@@H]1O
| StdInChI = 1S/C10H21Cl2N2O7P/c11-1-3-13-22(19,14-4-2-12)21-10-9(18)8(17)7(16)6(5-15)20-10/h6-10,15-18H,1-5H2,(H2,13,14,19)/t6-,7-,8+,9-,10+/m1/s1
| StdInChIKey = PSVUJBVBCOISSP-SPFKKGSWSA-N
}}
| Section2 = {{Chembox Properties
| C=10 | H=21 | Cl=2 | N=2 | O=7 | P=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Glufosfamide, also known as glucophosphamide, D-glucose isophosphoramide mustard, D-19575{{cite journal | doi = 10.1097/CAD.0b013e328345e1e0 | pmid = 21427562| title = Glufosfamide as a new oxazaphosphorine anticancer agent| date = 2011| last1 = Mazur| first1 = Lidia| last2 = Opydo-Chanek| first2 = Małgorzata| last3 = Stojak| first3 = Marta| journal = Anti-Cancer Drugs| volume = 22| issue = 6| pages = 488–493| s2cid = 398165}} is an experimental cytotoxic chemotherapeutic agent for treatment of malignancies.
Chemical structure
Glufosfamide is, basically, a glycosidic conjugate between β-D-glucose and the active alkylating moiety of the well-known antineoplastic drug ifosfamide, so-called "isophosphoramide mustard".
Theoretical advantages
Glufosfamide, being a conjugate of glucose and active alkylating moiety of ifosfamide, has the better cell permeability than the parent compound — ifosfamide — or its metabolites. Glufosfamide utilizes the normal cell glucose transport mechanism (a sodium-dependent glucose/sodium co-transporter) for its own transport into the cell. And the glucose uptake mechanism is grossly overexpressed and upregulated in certain cancer cell lines, especially pancreatic cancer, non-small cell lung cancer, and glioblastoma multiforme. This, theoretically, should render them more sensitive to the alkylating effects of glufosfamide while relatively sparing (doing relatively little collateral damage) to the normal cells in which the glucose uptake mechanism is not so upregulated.{{cite journal | pmid = 15801867| date = 2005| title = Glufosfamide: Beta-D-GLC-IPM, D 19575| journal = Drugs in R&D| volume = 6| issue = 1| pages = 49–52| doi = 10.2165/00126839-200506010-00006}}
Clinical trials
Glufosfamide demonstrated modest efficacy in Phase I and Phase II clinical trials in the treatment of pancreatic cancer, non-small cell lung cancer and recurrent glioblastoma multiforme.{{cite journal | pmid = 17430192| date = 2007| last1 = Liang| first1 = J.| last2 = Huang| first2 = M.| last3 = Duan| first3 = W.| last4 = Yu| first4 = X. Q.| last5 = Zhou| first5 = S.| title = Design of new oxazaphosphorine anticancer drugs| journal = Current Pharmaceutical Design| volume = 13| issue = 9| pages = 963–978| doi = 10.2174/138161207780414296}} A large Phase III trial comparing glufosfamide against 5-FU, both in combination with gemcitabine, for second line treatment of metastatic pancreatic cancer (NCT01954992) is currently active.{{cn|date=February 2023}}