guaiazulene

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 443851013

| Name = Guaiazulene

| ImageFile = Guajazulene skeletal.svg

| ImageName = Guaiazulene

| PIN = 1,4-Dimethyl-7-(propan-2-yl)azulene

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 489-84-9

| Beilstein = 1365001

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 5550

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1408759

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3395

| 3DMet = L00520

| DrugBank = DB13329

| EC_number = 207-701-2

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01037

| PubChem = 3515

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2OZ1K9JKQC

| InChI = 1/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3

| InChIKey = FWKQNCXZGNBPFD-UHFFFAOYAG

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FWKQNCXZGNBPFD-UHFFFAOYSA-N

| SMILES = CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C

}}

|Section2={{Chembox Properties

| C=15 | H=18

| Density = 0.976 g/cm³

| MeltingPtC = 31 to 33

| MeltingPt_notes =

| BoilingPtC = 153

| BoilingPt_notes = (7 mm Hg)

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = S01

| ATCCode_suffix = XA01

}}

}}

Guaiazulene, also azulon or 1,4-dimethyl-7-isopropylazulene, is a dark blue crystalline hydrocarbon. A derivative of azulene, guaiazulene is a bicyclic sesquiterpene that is a constituent of some essential oils, mainly oil of guaiac and chamomile oil, which also serve as its commercial sources. Various soft corals also contain guaiazulene as a principal pigment.{{Cite journal | doi = 10.1071/CH9830211| title = Studies of Australian soft corals. XXX. A novel trisnorsesquiterpene from a Cespitulariaspecies and the isolation of guaiazulene from a small blue Alcyoniumspecies| journal = Australian Journal of Chemistry| volume = 36| pages =211| year = 1983| last1 = Bowden| first1 = BF| last2 = Coll| first2 = JC| last3 = Tapiolas| first3 = DM}} Its low melting point makes guaiazulene difficult to handle, in contrast to the crystalline nature of the parent azulene. The electronic structure (and colors) of guaiazulene and azulene are very similar.