guanosine triphosphate

{{short description|Chemical compound}}

{{distinguish|Adenosine triphosphate}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477003555

| ImageFile = GTP.png

| ImageSize = 280

| ImageClass = skin-invert

| ImageAlt = Skeletal formula of guanosine triphosphate

| ImageFile1 = Guanosine-triphosphate-anion-3D-spacefill.png

| ImageSize1 = 220

| ImageAlt1 = Space-filling model of the guanosine triphosphate anion

| IUPACName = Guanosine 5′-(tetrahydrogen triphosphate)

| SystematicName = O1-{[(2R,3S,4R,5R)-5-(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl} tetrahydrogen triphosphate

| OtherNames = guanosine triphosphate, 9-β-D-ribofuranosylguanine-5'-triphosphate, 9-β-D-ribofuranosyl-2-amino-6-oxo-purine-5'-triphosphate

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6569

| InChI = 1/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1

| InChIKey = XKMLYUALXHKNFT-UUOKFMHZBF

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6-,9-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XKMLYUALXHKNFT-UUOKFMHZSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 86-01-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 01WV7J708X

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C00044

| PubChem = 6830

| IUPHAR_ligand = 1742

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 15996

| SMILES = c1nc2c(n1[C@H]3[C@@H]([C@@H]([C@H](O3)CO[P@@](=O)(O)O[P@](=O)(O)OP(=O)(O)O)O)O)[nH]c(nc2=O)N

| MeSHName = Guanosine+triphosphate

}}

| Section2 = {{Chembox Properties

| C=10|H=16|N=5|O=14|P=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Guanosine-5'-triphosphate (GTP) is a purine nucleoside triphosphate. It is one of the building blocks needed for the synthesis of RNA during the transcription process. Its structure is similar to that of the guanosine nucleoside, the only difference being that nucleotides like GTP have phosphates on their ribose sugar. GTP has the guanine nucleobase attached to the 1' carbon of the ribose and it has the triphosphate moiety attached to ribose's 5' carbon.

It also has the role of a source of energy or an activator of substrates in metabolic reactions, like that of ATP, but more specific. It is used as a source of energy for protein synthesis and gluconeogenesis.

GTP is essential to signal transduction, in particular with G-proteins, in second-messenger mechanisms where it is converted to guanosine diphosphate (GDP) through the action of GTPases.

Uses

=Energy transfer=

GTP is involved in energy transfer within the cell. For instance, a GTP molecule is generated by one of the enzymes in the citric acid cycle. This is tantamount to the generation of one molecule of ATP, since GTP is readily converted to ATP with nucleoside-diphosphate kinase (NDK).Stryer>{{cite book |last= Berg |first=JM |author2=JL Tymoczko |author3=L Stryer |title= Biochemistry|url= https://archive.org/details/biochemistry200100jere |url-access= registration |edition=5th |pages =[https://archive.org/details/biochemistry200100jere/page/476 476]|publisher= WH Freeman and Company |year=2002 |isbn= 0-7167-4684-0}}

=Genetic translation=

During the elongation stage of translation, GTP is used as an energy source for the binding of a new amino-bound tRNA to the A site of the ribosome. GTP is also used as an energy source for the translocation of the ribosome towards the 3' end of the mRNA.{{cite book |last=Solomon |first=EP |author2=LR Berg |author3=DW Martin |title= Biology |edition=7th |pages=244–245 |year=2005}}

=Microtubule dynamic instability=

During microtubule polymerization, each heterodimer formed by an alpha and a beta tubulin molecule carries two GTP molecules, and the GTP is hydrolyzed to GDP when the tubulin dimers are added to the plus end of the growing microtubule. Such GTP hydrolysis is not mandatory for microtubule formation, but it appears that only GDP-bound tubulin molecules are able to depolymerize. Thus, a GTP-bound tubulin serves as a cap at the tip of microtubule to protect from depolymerization; and, once the GTP is hydrolyzed, the microtubule begins to depolymerize and shrink rapidly.{{cite web | url = http://www.cytochemistry.net/Cell-biology/microtubule_structure.htm | title = Microtubule structure | author = Gwen V. Childs | publisher = cytochemistry.net | url-status = dead | archive-url = https://web.archive.org/web/20100215173527/http://www.cytochemistry.net/Cell-biology/microtubule_structure.htm | archive-date = 2010-02-15 }}

=Mitochondrial function=

The translocation of proteins into the mitochondrial matrix involves the interactions of both GTP and ATP. The importing of these proteins plays an important role in several pathways regulated within the mitochondria organelle,{{cite journal|last=Sepuri|first=Naresh Babu V. |author2=Norbert Schülke |author3=Debkumar Pain|title=GTP Hydrolysis Is Essential for Protein Import into the Mitochondrial Matrix|journal=Journal of Biological Chemistry|date=16 January 1998|volume=273 |issue=3|pages=1420–1424|doi=10.1074/jbc.273.3.1420|pmid=9430677 |doi-access=free}} such as converting oxaloacetate to phosphoenolpyruvate (PEP) in gluconeogenesis.{{fact|date=September 2017}}

Precursor for synthesis of riboflavin

GTP, in combination with ribulose 5-phosphate, are the precursor compounds for the synthesis of riboflavin (vitamin B2).{{cite book |vauthors=Merrill AH, McCormick DB |title = Present Knowledge in Nutrition, Eleventh Edition |chapter = Riboflavin |editor=BP Marriott |editor2=DF Birt |editor3=VA Stallings|editor4=AA Yates |publisher = Academic Press (Elsevier) |year=2020 |location = London, United Kingdom |pages = 189–208 |isbn=978-0-323-66162-1}}

Biosynthesis

In the cell, GTP is synthesised through many processes including:

See also

References