harmol

{{Chembox

| ImageFile = Harmol.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 1-Methyl-2,9-dihydropyrido[3,4-b]indol-7-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 487-03-6

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7PQ075MCA6

| PubChem = 68094

| ChemSpiderID = 10296888

| ChEBI = 192558

| SMILES = CC1=C2C(=C3C=CC(=O)C=C3N2)C=CN1}}

|Section2={{Chembox Properties

| C=12|H=10|N=2|O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Harmol is a chemical compound classified as a β-carboline.{{cite journal|vauthors=Abe A, Kokuba H | title=Harmol induces autophagy and subsequent apoptosis in U251MG human glioma cells through the downregulation of survivin | journal=Oncol Rep | year= 2013 | volume= 29 | issue= 4 | pages= 1333–42 | pmid=23338618 | doi=10.3892/or.2013.2242 | doi-access=free }}{{cite journal|vauthors=El Gendy MA, Soshilov AA, Denison MS, El-Kadi AO | title=Transcriptional and posttranslational inhibition of dioxin-mediated induction of CYP1A1 by harmine and harmol | journal=Toxicol Lett | year= 2012 | volume= 208 | issue= 1 | pages= 51–61 | pmid=22001777 | doi=10.1016/j.toxlet.2011.09.030 | pmc=3263333 }}{{cite journal|vauthors=Abe A, Yamada H, Moriya S, Miyazawa K | title=The β-carboline alkaloid harmol induces cell death via autophagy but not apoptosis in human non-small cell lung cancer A549 cells. | journal=Biol Pharm Bull | year= 2011 | volume= 34 | issue= 8 | pages= 1264–72 | pmid=21804216 | doi= 10.1248/bpb.34.1264| doi-access=free }} It is readily formed in vivo in humans by O-demethylation of harmine.{{cite journal|vauthors=Morales-Garcia JA, de la Fuenta Revenga M, Alonso-Gil S, Rodriguez-Franco MI, Feiding A, Perez-Castillo A, Riba J | title=The alkaloids of Banisteriopsis caapi, the plant source of the Amazonian hallucinogen Ayahuasca, stimulate adult neurogenesis in vitro | journal=Sci. Rep. | volume=7 | issue=1 | pages=5309 | year=2017 | pmid=28706205 | pmc=5509699 | doi=10.1038/s41598-017-05407-9 | bibcode=2017NatSR...7.5309M }}