heptabarb

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443853293

| IUPAC_name = 5-cyclohept-1-en-1-yl-5-ethylpyrimidine-2,4,6(1H,3H,5H)-trione

| image = Heptabarbital structure.svg

| width = 135

| tradename =

| pregnancy_category =

| legal_status =

| legal_CA = Schedule IV

| routes_of_administration = Oral{{cite journal |vauthors=Breimer DD, de Boer AG | title = Pharmacokinetics and relative bioavailability of heptabarbital and heptabarbital sodium after oral administration to man | journal = European Journal of Clinical Pharmacology | volume = 9 | issue = 2–3 | pages = 169–78 |date=December 1975 | pmid = 9299 | doi = 10.1007/bf00614014| s2cid = 32380531 }}

| bioavailability = 83%

| metabolism = Hepatic

| elimination_half-life = 6.1-11.2 hours

| excretion = Renal

| CAS_number = 509-86-4

| ATC_prefix = N05

| ATC_suffix = CA11

| PubChem = 10518

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01354

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10081

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V10R70ML23

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C17725

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 468837

| synonyms = G-475

| C=13 | H=18 | N=2 | O=3

| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCCC2)CC

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H18N2O3/c1-2-13(9-7-5-3-4-6-8-9)10(16)14-12(18)15-11(13)17/h7H,2-6,8H2,1H3,(H2,14,15,16,17,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PAZQYDJGLKSCSI-UHFFFAOYSA-N

}}

Heptabarb (INN; Eudan, Medapan, Medomin, Noctyn), also known as heptabarbitone (BAN) or heptabarbital, is a sedative and hypnotic drug of the barbiturate family.{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1003 | access-date = 26 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1003}}{{cite book | title = Index nominum 2000: international drug directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA513 | access-date = 26 November 2011 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 513}} It was used in Europe for the treatment of insomnia from the 1950s onwards, but has since been discontinued.

See also

References

{{Reflist}}

{{Hypnotics and sedatives}}

{{GABAAR PAMs}}

Category:Barbiturates

Category:Hypnotics

Category:Pyrimidines

Category:Sedatives

Category:Cycloalkenes

{{sedative-stub}}