heptanitrocubane

{{Chembox

| verifiedrevid = 438282247

| ImageFile = Heptanitrocubane.svg

| ImageName = Structural formula

| ImageFile1 = Heptanitrocubane-3D-balls.png

| ImageName1 = Ball-and-stick model

| PIN=1,2,3,4,5,6,7-Heptanitrocubane

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9907240

| InChI = 1/C8HN7O14/c16-9(17)2-1-3(10(18)19)5(2,12(22)23)8(15(28)29)6(2,13(24)25)4(1,11(20)21)7(3,8)14(26)27/h1H

| InChIKey = GUPWSTKEIMSQHI-UHFFFAOYAQ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8HN7O14/c16-9(17)2-1-3(10(18)19)5(2,12(22)23)8(15(28)29)6(2,13(24)25)4(1,11(20)21)7(3,8)14(26)27/h1H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GUPWSTKEIMSQHI-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=99393-62-1

| PubChem=11732527

| SMILES = [O-][N+](=O)C14C3C2([N+]([O-])=O)C1([N+]([O-])=O)C5([N+]([O-])=O)C2([N+]([O-])=O)C3([N+]([O-])=O)C45[N+]([O-])=O

}}

|Section2={{Chembox Properties

| C=8 | H=1 | N=7 | O=14

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards= Explosive

| FlashPt=

| AutoignitionPt =

}}

|Section8={{Chembox Related

| OtherCompounds = Cubane
Octanitrocubane
2,4,6-Tris(trinitromethyl)-1,3,5-triazine
4,4’-Dinitro-3,3’-diazenofuroxan
Hexanitrohexaazaisowurtzitane

}}

}}

Heptanitrocubane {{IPAc-en|ˌ|h|ɛ|p|t|ə|ˌ|n|aɪ|t|r|oʊ|ˈ|k|j|uː|b|eɪ|n}} is an experimental high explosive based on the cubic eight-carbon cubane molecule and closely related to octanitrocubane. Seven of the eight hydrogen atoms at the corners of the cubane molecule are replaced by nitro groups, giving the final molecular formula {{chem2|C8H(NO2)7}}.

As with octanitrocubane, not enough heptanitrocubane has been synthesized to perform detailed tests on its stability and energy. It is hypothesized to have slightly better performance than explosives such as HMX, the current high-energy standard explosive, based on chemical energy analysis. While in theory not as energetic as octanitrocubane's theoretical maximum density, the heptanitrocubane that has been synthesized so far is a more effective explosive than any octanitrocubane that has been produced, due to more efficient crystal packing and hence higher density.{{cite journal|doi=10.1016/j.theochem.2004.05.012|title=Molecular electrostatic potentials and electron densities in nitrocubanes C8H8−α(NO2)α (α=1–8): Ab initio and density functional study|year=2004|last1=Gejji|first1=Shridhar P|last2=Patil|first2=Ujwala N|last3=Dhumal|first3=Nilesh R|journal=Journal of Molecular Structure: THEOCHEM|volume=681| issue=1–3 |pages=117–127}}

Heptanitrocubane was first synthesized by the same team who synthesized octanitrocubane, Philip Eaton and Mao-Xi Zhang at the University of Chicago, in 1999.

{{Cite journal|author1=Mao-Xi Zhang |author2=Philip E. Eaton |author3=Richard Gilardi | title = Hepta- and Octanitrocubanes| journal = Angewandte Chemie International Edition| year = 2000| volume = 39| issue = 2| pages= 401–404| doi = 10.1002/(SICI)1521-3773(20000117)39:2<401::AID-ANIE401>3.0.CO;2-P| pmid=10649425}}

References

Further reading

  • {{cite book |doi=10.1002/9780470682531.pat0333 |chapter=Chemistry of Cubane and Other Prismanes |title=PATAI's Chemistry of Functional Groups |year=2009 |last1=Bashir-Hashemi |first1=A. |last2=Higuchi |first2=Hiroyuki |isbn=9780470682531}}

Category:Explosive chemicals

Category:Nitroalkanes