hexafluronium bromide

{{Short description|Pharmaceutical drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461767845

| IUPAC_name = N,N-di-9H-fluoren-9-yl-N,N,N',N'-tetramethylhexane-1,6-diaminium dibromide

| image = Hexafluronium bromide.svg

| width = 250px

| drug_name = Hexafluronium

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 317-52-2

| ATC_prefix = M03

| ATC_suffix = AC05

| PubChem = 9434

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00941

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 9063

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = B64NJG83K2

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04435

| C=36 | H=42 | Br=2 | N=2

| smiles = [Br-].[Br-].c1cccc3c1c2c(cccc2)C3[N+](CCCCCC[N+](C6c4ccccc4c5ccccc56)(C)C)(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C36H42N2.2BrH/c1-37(2,35-31-21-11-7-17-27(31)28-18-8-12-22-32(28)35)25-15-5-6-16-26-38(3,4)36-33-23-13-9-19-29(33)30-20-10-14-24-34(30)36;;/h7-14,17-24,35-36H,5-6,15-16,25-26H2,1-4H3;2*1H/q+2;;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WDEFPRUEZRUYNW-UHFFFAOYSA-L

}}

Hexafluronium (or hexafluorenium) is a muscle relaxant.{{cite journal | vauthors = Baraka A | title = Hexafluorenium-suxamethonium interaction in patients with normal versus atypical cholinesterase | journal = British Journal of Anaesthesia | volume = 47 | issue = 8 | pages = 885–8 | date = August 1975 | pmid = 1201167 | doi = 10.1093/bja/47.8.885 | doi-access = free }} It acts as a nicotinic acetylcholine receptor antagonist.