hexapradol

{{Short description|Group of stereoisomers}}

{{Drugbox

| IUPAC_name = 2-amino-1,1-diphenyl-1-heptanol

| image = Hexapradol_structure.png

| CAS_number = 15599-37-8

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = I71G9YBD89

| ATC_prefix = None

| ATC_suffix =

| PubChem = 219120

| ChEMBL = 2107201

| ChemSpiderID = 189933

| C=19 | H=25 | N=1 | O=1

| smiles = OC(c1ccccc1)(c2ccccc2)C(N)CCCCC

| synonyms = α-Butyl-β-hydroxy-β-phenylamphetamine; α-Pentyl-β-hydroxy-β-phenyl-2-phenethylamine; β-Phenyl-2-phenylheptanolamine

| StdInChI = 1S/C19H25NO/c1-2-3-6-15-18(20)19(21,16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18,21H,2-3,6,15,20H2,1H3

| StdInChIKey = ZVRZJTRBWTVKOJ-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Hexapradol (INN) is a psychostimulant drug which was never marketed.{{cite book | vauthors = Ganellin CR, Triggle DJ | title = Dictionary of Pharmacological Agents | volume = 2 |date = 21 November 1996| url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1023 | access-date = 26 April 2012 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1023}}

It also had cytoprotective/antiulcer properties.{{cite journal | vauthors = Scuri R, Mondani G, Fantini PL, Dàlla Valle V, Valsecchi B | title = Hexaprazol: a new antiulcer drug with a cytoprotective action | journal = Bollettino Chimico Farmaceutico | volume = 123 | issue = 9 | pages = 425–38 | date = September 1984 | pmid = 6529496 }}