hexenuronic acid

{{Chembox

| Name = Hexenuronic acid

| ImageFile = Hexenuronic acid.svg

| OtherNames = 4-deoxy-4-hexenopyranosyluronic acid
4-deoxy-beta-L-threo-hex-4-enopyranosyluronic acid

| IUPACName = (2S,3R,4S)-3,4-dihydroxy-2-[(2R,3R,4S,5R)-4-hydroxy-2,5-dimethoxyoxan-3-yl]oxy-3,4-dihydro-2H-pyran-6-carboxylic acid

| Section1 = {{Chembox Identifiers

| Abbreviations = HexA

| CASNo =

| PubChem = 102073560

| ChemSpiderID =

| EC_number =

| UNNumber =

| DrugBank =

| KEGG =

| MeSHName = C095263

| ChEBI =

| RTECS =

| SMILES = CO[C@@H]1CO[C@H]([C@@H]([C@H]1O)O[C@@H]2[C@@H]([C@H](C=C(O2)C(=O)O)O)O)OC

| InChI = 1S/C13H20O10/c1-19-7-4-21-13(20-2)10(9(7)16)23-12-8(15)5(14)3-6(22-12)11(17)18/h3,5,7-10,12-16H,4H2,1-2H3,(H,17,18)/t5-,7+,8+,9-,10+,12+,13+/m0/s1

| InChIKey = YIUVUZOUGAOFMC-CAIVYNQRSA-N

| Beilstein =

| Gmelin =

| 3DMet = }}

| Section2 = {{Chembox Properties

| C = 13 | H = 20 | O = 10

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

}}

| Section7 = {{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-I =

| NFPA-S =

| ExternalSDS =

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

| FlashPt =

| LD50 =

| PEL =

}}

| Section8 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction_label =

| OtherFunction =

| OtherCompounds =

}}

}}

Hexenuronic acid (HexA) is an organic compound with the formula C13H20O10.{{cite journal | vauthors = Cadena EM, Vidal T, Torres AL | title = Influence of the hexenuronic acid content on refining and ageing in eucalyptus TCF pulp | journal = Bioresource Technology | volume = 101 | issue = 10 | pages = 3554–3560 | date = May 2010 | pmid = 20074936 | doi = 10.1016/j.biortech.2009.11.105 | bibcode = 2010BiTec.101.3554C }}{{Cite journal | vauthors = Chakar FS, Allison L, Ragauskas AJ, McDonough TJ, Sezgi US |date=November 2000 |title=Influence of hexenuronic acids on us bleaching operations |url=https://imisrise.tappi.org/TAPPI/Products/00/NOV/00NOV62.aspx |journal=TAPPI Journal |volume=83 |issue=11}} It is an unsaturated sugar produced during the kraft process in the creation of wood pulp.

Kraft process

During the kraft process, which is the turning of wood into wood pulp for papermaking, wood chips are treated with sodium hydroxide and sodium sulfide. Sodium hydroxide catalyzes the demethylation of 4-O-methyl-D-glucuronoxylan, which is found at the ends of the polysaccharide xylan.{{Cite journal | vauthors = Petit-Breuilh X, Zaror C, Melo R |date=December 2004 |title=Hexenuronic acid removal from unbleached kraft eucalyptus pulp by peroxymonosulfuric acid |url=http://www.scielo.cl/scielo.php?script=sci_abstract&pid=S0717-97072004000400016&lng=en&nrm=iso&tlng=en |journal=Journal of the Chilean Chemical Society |volume=49 |issue=4 |pages=355–360 |doi=10.4067/S0717-97072004000400016 |issn=0717-9707|doi-access=free }}

File:Dehydration of 4-O-methyl-D-glucuronoxylan.png

Hexenuronic acid decreases a wood's kappa number, which is a measure of bleachability of wood pulp, by 3-7. It readily reacts with common wood pulp bleaching agents like ozone, peracetic acid, and chlorine dioxide. Consequently, research has focused on ways to break down hexenuronic acid prior to bleaching to decrease dangerous waste products and costs.

The main method of destroying hexenuronic acid is to treat the wood pulp post kraft processing with strong acids at high temperatures. HexA is hydrolyzed and broken down into aldehydes and alcohols like 2-furoic acid and 5-carboxy-2-furaldehdye. This process has led to a 50% reduction in bleaching costs of the wood pulp in some cases.

In microbes

Polysaccharide lyases (PL) are a type of enzyme that is found in numerous microorganisms including bacteriophages that break down parts of wood.{{cite journal | vauthors = Sutherland IW | title = Polysaccharide lyases | journal = FEMS Microbiology Reviews | volume = 16 | issue = 4 | pages = 323–347 | date = July 1995 | pmid = 7654407 | doi = 10.1111/j.1574-6976.1995.tb00179.x | doi-access = free }} PL catalyzses β-elimination of uronic acid-containing polysaccharides into HexA.{{cite journal | vauthors = Quan Y, da Silva NM, de Souza Lima BJ, de Hoog S, Vicente VA, Mayer V, Kang Y, Shi D | display-authors = 6 | title = Black fungi and ants: a genomic comparison of species inhabiting carton nests versus domatia | journal = IMA Fungus | volume = 13 | issue = 1 | pages = 4 | date = March 2022 | pmid = 35256015 | pmc = 8900376 | doi = 10.1186/s43008-022-00091-5 | doi-access = free }}

References