hexobendine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444607795

| IUPAC_name = Ethane-1,2-diylbis[(methylimino)propane-3,1-diyl] bis(3,4,5-trimethoxybenzoate)

| image = Hexobendine.png

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| ATC_prefix = C01

| ATC_suffix = DX06

| PubChem = 5777

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B6X4SYR93B

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 54-03-5

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 5573

| C=30 | H=44 | N=2 | O=10

| smiles = COc1c(cc(cc1OC)C(=O)OCCCN(C)CCN(C)CCCOC(=O)c2cc(OC)c(OC)c(OC)c2)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C30H44N2O10/c1-31(11-9-15-41-29(33)21-17-23(35-3)27(39-7)24(18-21)36-4)13-14-32(2)12-10-16-42-30(34)22-19-25(37-5)28(40-8)26(20-22)38-6/h17-20H,9-16H2,1-8H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KRQAMFQCSAJCRH-UHFFFAOYSA-N

}}

Hexobendine is a vasodilator that acts as an adenosine reuptake inhibitor.{{cite journal | vauthors = Kolassa N, Pfleger K | title = Adenosine uptake by erythrocytes of man, rat and guinea-pig and its inhibition by hexobendine and dipyridamole | journal = Biochemical Pharmacology | volume = 24 | issue = 1 | pages = 154–6 | date = January 1975 | pmid = 1168469 | doi = 10.1016/0006-2952(75)90331-7 | url = http://ukpmc.ac.uk/abstract/MED/1168469 | url-access = subscription }}

Synthesis

Hexobendine can be synthesized starting with a reaction between 3,4,5-trimethoxybenzoyl chloride (1) and 3-chloropropanol (2) to give the corresponding ester, 3-chloropropyl 3,4,5-trimethoxybenzoate (3). The last step involves the reaction between two molar equivalents of 3 with one molar equivalent of 1,2-dimethylethylenediamine (4) completing the synthesis of hexobendine (5).{{cite web | url = https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-08-0024 | title = Pharmaceutical Substances: Hexobendine | publisher = Thieme }}AT231432 idem Schlogl Karl, Kraupp Otto, {{US patent|3267103}} (1964 & 1966 to Chemie Linz Ag).

:File:Hexobendine synthesis.svg{{clear-left}}

==See also ==

References

{{Reflist}}

{{Vasodilators used in cardiac diseases}}

{{Purinergics}}

Category:Vasodilators

Category:Phenol ethers

Category:Benzoate esters

Category:Amines

Category:Adenosine reuptake inhibitors

{{cardiovascular-drug-stub}}