hispidulin
{{Chembox
| ImageFile = Hispidulin.svg
| ImageSize = 150px
| ImageAlt =
| IUPACName = 4′,5,7-Trihydroxy-6-methoxyflavone
| SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 1447-88-7
| CASNo_Ref = {{Cascite|changed|CAS}}
| PubChem = 5281628
| ChEBI = 75902
| SMILES = COc1c(O)cc2oc(cc(=O)c2c1O)-c1ccc(O)cc1
| ChemSpiderID = 4444947
| EINECS = 802-856-8
| UNII = N7F61604C2
| InChI = 1/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3
| InChIKey = IHFBPDAQLQOCBX-UHFFFAOYAV
| StdInChI = 1S/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3
| StdInChIKey = IHFBPDAQLQOCBX-UHFFFAOYSA-N
| KEGG = C10058}}
|Section2={{Chembox Properties
| Formula = C16H12O6
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Hispidulin is a naturally occurring flavone with potential antiepileptic activity in rats and gerbils.Hispidulin inhibits the release of glutamate in rat cerebrocortical nerve terminals. Lin TY1, Lu CW, Wang CC, Lu JF, Wang SJ. Toxicol Appl Pharmacol. 2012 Sep 1;263(2):233-43. doi: 10.1016/j.taap.2012.06.015. Epub 2012 Jul 1.The flavone hispidulin, a benzodiazepine receptor ligand with positive allosteric properties, traverses the blood–brain barrier and exhibits anticonvulsive effects, Dominique Kavvadias et al, British Journal of Pharmacology (2004) 142, 811–820 It is found in plants including Grindelia argentina, Arrabidaea chica, Saussurea involucrate, Crossostephium chinense, Artemisia, and Salvia.
Complementary medicine
In traditional and complementary medicine it is claimed to have "antioxidant, antifungal, anti-inflammatory, antimutagenic, and antineoplastic properties".Kanika Patel, Dinesh Kumar Patel, Medicinal importance, pharmacological activities, and analytical aspects of hispidulin: A concise report, Journal of Traditional and Complementary Medicine, 2016, ISSN 2225-4110, https://dx.doi.org/10.1016/j.jtcme.2016.11.003.
Notes
{{Reflist}}
{{Flavones}}
{{GABAAR PAMs}}
Category:O-methylated flavones
Category:GABAA receptor positive allosteric modulators
{{aromatic-stub}}