homofenazine

{{Short description|Antipsychotic medication}}

{{For|the current use of the Pasaden brand|Etizolam}}

{{Infobox drug

| Watchedfields =

| verifiedrevid =

| INN =

| IUPAC_name =

| drug_name =

| synonyms = HFZ{{Cite book |url=https://archive.org/details/martindalecomple0035unse/page/898/mode/2up?q=Homofenazine |title=Martindale: the complete drug reference |date=2007 |publisher=Pharmaceutical Press |isbn=978-0-85369-687-2 |location=London; Chicago |pages=899 |language=en |oclc=1176310249}}

| type =

| image = Homofenazine.svg

| image_class = skin-invert-image

| width =

| alt =

| caption =

| image2 =

| width2 =

| pronounce =

| tradename = Pasaden,{{Cite book |url=https://archive.org/details/1991drugsavailab0000unse/page/106/mode/2up?q=Homofenazine |title=1991 Drugs available abroad: a guide to therapeutic drugs available and approved outside the U.S. |vauthors=Schlesser JL |date=1990 |publisher=Detroit : Gale Research |isbn=978-0-8103-7177-4 |pages=107 |oclc=1348900780}}{{Cite news |date=1986-11-05 |title=Substâncias e remédios sob controle |language=pt-br |trans-title=Substances and drugs under control |pages=14 |work=Jornal do Brasil |url=https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |url-status=live |access-date=2023-08-08 |archive-url=https://web.archive.org/web/20230808230340/https://memoria.bn.br/pdf/030015/per030015_1986_00211.pdf |archive-date=2023-08-08}} Oldagen (in Argentina){{Cite book |url={{google books|plainurl=y|id=5GpcTQD_L2oC|page=1501}} |title=Index Nominum 2000: International Drug Directory |date=2000 |publisher=Taylor & Francis |isbn=9783887630751 |edition=17 |publication-date=2000 |pages=1499}}{{Cite book |last=Sitting |first=Marshall |url=https://archive.org/details/Pharmaceutical_Manufacturing_Encyclopedia_Vols_12_2nd_Ed/page/769 |title=Pharmaceutical Manufacturing Encyclopedia (Vols 1&2, 2nd Ed) |date=1988 |publisher=Noyes Publications |isbn=0-8155-1144-2 |edition=2 |location=Westwood, NJ |pages=769 |language=en |lccn=87-31547 |oclc=52233518}}

| Drugs.com =

| MedlinePlus =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| ATC_prefix = N05A

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR = C1

| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-03 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| bioavailability =

| metabolism =

| protein_bound =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 3833-99-6

| PubChem = 19687

| IUPHAR_ligand =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18545

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = PEL7G6VRZ2

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 59071

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 2105000

| C = 23| H = 28| F= 3| N = 3| O = 1| S = 1

| SMILES = C1CN(CCN(C1)CCO)CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H28F3N3OS/c24-23(25,26)18-7-8-22-20(17-18)29(19-5-1-2-6-21(19)31-22)12-4-11-27-9-3-10-28(14-13-27)15-16-30/h1-2,5-8,17,30H,3-4,9-16H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LOHNHQLZFYCAEQ-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point = 230-240

| boiling_notes = {{Cite book |url={{google books|plainurl=y|id=0vXTBwAAQBAJ|page=635}} |title=Dictionary of Drugs |date=1990 |publisher=Springer US |isbn=978-1-4757-2087-7 | veditors = Elks J, Ganellin CR |location=Boston, MA |pages=635 |language=en |doi=10.1007/978-1-4757-2085-3 }}

| solubility =

| sol_units =

| specific_rotation =

}}

Homofenazine is an antipsychotic drug of the phenothiazines class. It was synthesized by Wilhelm Schuler and colleagues at Degussa.{{Cite book |url=https://archive.org/details/merckindexencycl0000unse/page/810/mode/2up |title=The Merck index : an encyclopedia of chemicals, drugs, and biologicals |date=1996 |publisher=Whitehouse Station, NJ : Merck |isbn=978-0-911910-12-4 |oclc=1285743402 |pages=810}}{{cite patent |country= US |number= 3040043 |inventor= Schuler et al. |status= patent |title= 3-trifluoromethyl-10-[3'-(4"-(2"'-hydroxy ethyl)-homopiperazino)-propyl]-phenothiazine and 3-trifluoromethyl-10-[3'-(4"-(2"'-acetoxyethyl)-homopiperazino)-propyl]-phenothiazine |pubdate=1962-06-19 |gdate=1962-06-19 |fdate=1960-03-14 |assign1= Degussa}}. In 1966, it was released in Belgium under the brand name Pasaden. At some point, it was quietly discontinued and is no longer marketed.{{citation needed|date=August 2023}}