hydrazobenzene

{{Chembox

|ImageFile = 1,2-diphenylhydrazine.svg

|ImageSize = 200px

|PIN = 1,2-Diphenylhydrazine

|OtherNames = {{bulletedlist|N,N′-Diphenylhydrazine|N,N′-Bianiline}}

|Section1 = {{Chembox Identifiers

|CASNo = 122-66-7

|CASNo_Ref = {{cascite|correct|CAS}}

| ChEMBL = 558459

| ChemSpiderID = 28962

| EC_number = 204-563-5

|PubChem = 31222

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = 1G3CS09TUK

| UNNumber = 2811

|SMILES = c1ccc(cc1)NNc2ccccc2

|StdInChI=1S/C12H12N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10,13-14H

|StdInChIKey = YBQZXXMEJHZYMB-UHFFFAOYSA-N

}}

|Section2 = {{Chembox Properties

|C=12|H=12|N=2

|MeltingPtC = 123-126

|MeltingPt_ref = {{Cite web | url = http://www.sigmaaldrich.com/catalog/product/aldrich/126721 | title = Hydrazobenzene | publisher = Sigma-Aldrich}}

}}

|Section7 = {{Chembox Hazards

| GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/31222#section=Safety-and-Hazards]

| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|302|350|410}}

| PPhrases = {{P-phrases|203|264|270|273|280|301+317|318|330|391|405|501}}

}}

}}

Hydrazobenzene (1,2-diphenylhydrazine) is an aromatic organic compound consisting of two aniline groups joined via their nitrogen atoms. It is an important industrial chemical used in the manufacture of dyes, pharmaceuticals, and hydrogen peroxide.{{cite web |url= https://ntp.niehs.nih.gov/ntp/roc/content/profiles/hydrazobenzene.pdf |accessdate= June 21, 2017 |title= Hydrazobenzene |work= Report on Carcinogens, Fourteenth Edition |publisher= National Toxicology Program, Department of Health and Human Services }}