hydrocortisone aceponate

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407390255

| image = Hydrocortisone aceponate.svg

| alt =

| tradename = Cortavance, others

| Drugs.com = {{drugs.com|monograph|hydrocortisone}}

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration = Topical

| class = Corticosteroid

| ATC_prefix = D07

| ATC_suffix = AC16

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title=Cortaderm EPAR | website=European Medicines Agency (EMA) | date=17 June 2022 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/cortaderm | access-date=9 February 2024}}{{cite web | title=Alcort EPAR | website=European Medicines Agency (EMA) | date=16 February 2024 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/alcort | access-date=26 December 2024}}{{cite web | title=Alcort Product information | website=Union Register of veterinary medicinal products | date=9 April 2024 | url=https://ec.europa.eu/health/documents/community-register/html/v306.htm | access-date=29 August 2024}}{{cite web | title=Cortavance PI | website=Union Register of medicinal products | date=11 January 2007 | url=https://ec.europa.eu/health/documents/community-register/html/v069.htm | access-date=26 December 2024}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism = Liver

| elimination_half-life = 6-8 hours

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 74050-20-7

| PubChem = 68921

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB14538

| ChEBI = 135746

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2106309

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 2340UP1L2G

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06876

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 62148

| IUPAC_name = (11β)-21-(acetyloxy)-11-hydroxy-3,20-dioxopregn-4-en-17-yl propionate

| C = 26

| H = 36

| O = 7

| SMILES = CCC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)O)C)C(=O)COC(=O)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C26H36O7/c1-5-22(31)33-26(21(30)14-32-15(2)27)11-9-19-18-7-6-16-12-17(28)8-10-24(16,3)23(18)20(29)13-25(19,26)4/h12,18-20,23,29H,5-11,13-14H2,1-4H3/t18-,19-,20-,23+,24-,25-,26-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = MFBMYAOAMQLLPK-FZNHGJLXSA-N

}}

Hydrocortisone aceponate is a veterinary corticosteroid that is used in form of creams for the treatment of various dermatoses (skin conditions).{{cite journal |vauthors = Mukhopadhyay AK, Baghel V |title = A study to evaluate the efficacy and safety of hydrocortisone aceponate 0.127% lipophilic cream in steroid responsive dermatoses in Indian patients |journal = Indian Journal of Dermatology, Venereology and Leprology |volume = 76 |issue = 5 |pages = 591 |year = 2010 |pmid = 20827017 |doi = 10.4103/0378-6323.69093 |doi-access = free}} It is an ester of hydrocortisone (cortisol) with acetic acid and propionic acid.

Medical uses

Hydrocortisone aceponate is typically used for skin conditions in veterinary practices for dogs. In this instance, it can be used on acute otitis externa,{{cite web|date=24 February 2021|title=Easotic EPAR |url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/easotic|website=European Medicines Agency (EMA)}} a bacterial infection causing inflammation of the ear canal, as well as a treatment for itchy skin caused by allergies.{{cite web|date=24 September 2021|title=Cortavance EPAR |url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/cortavance| work = European Medicines Agency (EMA) }} Additionally, hydrocortisone aceponate can be used to treat hormonal disorders and immune and allergic disorders.{{Cite web|title=Hydrocortisone aceponate|url=https://go.drugbank.com/drugs/DB14538|access-date=29 November 2021|work = DrugBank }}{{Unreliable medical source|date=February 2024}} The main use for hydrocortisone aceponate is for atopic skin conditions and acute ear infections. It is shown to help with skin lesions and inflammation that respond to corticosteroids but may have been resistant to other treatments. It has been approved for veterinary use in the European Union.

=Adverse effects =

Side effects include:

Inhibition of bone formation
Suppression of calcium absorption
Delayed wound healing
Redness on skin

Chemistry

Hydrocortisone aceponate is a steroid which takes the form of a diester. The diester increases transmission of the medicine through the skin and also increases the time that it remains in the affected area.{{cite journal | vauthors = Takahashi K, Sakano H, Numata N, Kuroda S, Mizuno N | title = Effect of fatty acid diesters on permeation of anti-inflammatory drugs through rat skin | journal = Drug Development and Industrial Pharmacy | volume = 28 | issue = 10 | pages = 1285–1294 | date = November 2002 | pmid = 12476874 | doi = 10.1081/ddc-120015362 | s2cid = 26471775 }}

Society and culture

= Brand names =

Cortavance is the brand name for a veterinary medication used to treat inflamed, itchy skin, typically caused by allergies.

Easotic is the brand name for a veterinary combination medication used to treat acute ear infections in dogs. It is composed of three active substances: hydrocortisone aceponate, miconazole nitrate and gentamicin. These are used in conjunction with hydrocortisone aceponate acts as an anti-inflammatory agent, miconazole nitrate has antifungal properties, and gentamicin is an antibiotic. The medication is used through ear drops and works to kill the foreign agent, prevent further spread, and mitigate symptoms.

References

Category:Corticosteroids

Category:Propionate esters

Category:Acetate esters

Category:Corticosteroid esters

Category:Dog medications