hydromadinone acetate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(6S,8R,9S,10R,13S,14S,17R)-17-Acetyl-6-chloro-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate

| image = Hydromadinone acetate.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Progestogen; Progestogen ester

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 2477-73-8

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 200665

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID = 173710

| UNII = X8WV0125VZ

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = NSC-33170; Chloroacetoxyprogesterone; CAP; 6α-Chloro-17α-acetoxyprogesterone; 6α-Chloro-17α-acetoxypregn-4-ene-3,20-dione

| C=23 | H=31 | Cl=1 | O=4

| SMILES = CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C[C@@H](C4=CC(=O)CC[C@]34C)Cl)C)OC(=O)C

| StdInChI_Ref =

| StdInChI = 1S/C23H31ClO4/c1-13(25)23(28-14(2)26)10-7-18-16-12-20(24)19-11-15(27)5-8-21(19,3)17(16)6-9-22(18,23)4/h11,16-18,20H,5-10,12H2,1-4H3/t16-,17+,18+,20+,21-,22+,23+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = DCVGANSDLNPXGO-WXLIAARGSA-N

}}

Hydromadinone acetate (developmental code name NSC-33170), also known as chloroacetoxyprogesterone (CAP), as well as 6α-chloro-17α-acetoxyprogesterone or 6α-chloro-17α-acetoxypregn-4-ene-3,20-dione, is a steroidal progestin of the 17α-hydroxyprogesterone group that was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA255|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=255–}}{{cite book| vauthors = Negwer M, Scharnow H |title=Organic-chemical drugs and their synonyms: (an international survey)|url=https://books.google.com/books?id=1nBqAAAAMAAJ|year=2001|publisher=Wiley-VCH|isbn=978-3-527-30247-5|page=3723}} It is the C17α acetate ester of hydromadinone, which, similarly, was never marketed.