hydroxynefazodone

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 2-[3-[4-(3-Chlorophenyl)piperazin-1-yl]propyl]-5-(1-hydroxyethyl)-4-(2-phenoxyethyl)-1,2,4-triazol-3-one

| image = Hydroxynefazodone.svg

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| class =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 1.5–4 hours{{cite book | vauthors = Golden RN, Dawkins K, Nicholas L | chapter = Trazodone and Nefazodone | veditors = Schatzberg AF, Nemeroff CB |title=The American Psychiatric Association Publishing Textbook of Psychopharmacology| edition = Fifth | chapter-url = https://books.google.com/books?id=KfHEDgAAQBAJ&pg=PA460 |year=2017 |publisher=American Psychiatric Pub |isbn=978-1-58562-523-9 |pages=460–}}

| excretion =

| CAS_number_Ref =

| CAS_number = 98159-82-1

| CAS_supplemental =
98159-83-2 (dihydrochloride)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 325402PVUU

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 11755137

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 9929840

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = OH-NEF

| C=25 | H=32 | Cl=1 | N=5 | O=3

| SMILES = CC(C1=NN(C(=O)N1CCOC2=CC=CC=C2)CCCN3CCN(CC3)C4=CC(=CC=C4)Cl)O

| StdInChI_Ref =

| StdInChI = 1S/C25H32ClN5O3/c1-20(32)24-27-31(25(33)30(24)17-18-34-23-9-3-2-4-10-23)12-6-11-28-13-15-29(16-14-28)22-8-5-7-21(26)19-22/h2-5,7-10,19-20,32H,6,11-18H2,1H3

| StdInChIKey_Ref =

| StdInChIKey = VKGQYGXMUUBRBD-UHFFFAOYSA-N

}}

Hydroxynefazodone is a phenylpiperazine compound and a major metabolite of the antidepressant nefazodone.{{cite book | vauthors = Preskorn SH, Catterson ML | chapter = General Principles of Pharmacokinetics | veditors = Preskorn SH, Stanga CY, Feighner JP, Ross R |title=Antidepressants: Past, Present and Future | chapter-url = https://books.google.com/books?id=Ue3uCAAAQBAJ&pg=PA68|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-3-642-18500-7|pages=68–}}{{cite journal | vauthors = Davis R, Whittington R, Bryson HM | title = Nefazodone. A review of its pharmacology and clinical efficacy in the management of major depression | journal = Drugs | volume = 53 | issue = 4 | pages = 608–636 | date = April 1997 | pmid = 9098663 | doi = 10.2165/00003495-199753040-00006 | s2cid = 239077479 }} It has similar biological activity and a similar elimination half-life (1.5 to 4 hours) to those of nefazodone, and may contribute significantly to its effects.