hydroxystenozole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = verified

| Watchedfields = verified

| verifiedrevid = 443918312

| IUPAC_name = (1S,3aS,3bR,10aR,10bS,12aS)-1,10a,12a-trimethyl-1,2,3,3a,3b,4,5,7,10,10a,10b,11,12,12a-tetradecahydrocyclopenta[5,6]naphtho[1,2-f]indazol-1-ol

| image = Hydroxystenozole.png

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Androgen; Anabolic steroid

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 19120-01-5

| CAS_supplemental =
5697-57-4

| ATC_prefix = None

| ATC_suffix =

| ATC_supplemental =

| PubChem = 238684

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 208502

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5OW19U0553

| KEGG =

| ChEBI = 79555

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 2105010

| synonyms = NSC-43194; 4-Dehydrostanozolol; 17α-Methyl-2'H-androsta-2,4-dieno[3,2-c]pyrazol-17β-ol

| C=21 | H=30 | N=2 | O=1

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C)O)CCC4=CC5=C(C[C@]34C)C=NN5

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H30N2O/c1-19-11-13-12-22-23-18(13)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h10,12,15-17,24H,4-9,11H2,1-3H3,(H,22,23)/t15-,16+,17+,19+,20+,21+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OIIHTRLQCQVVQC-OBQKJFGGSA-N

}}

Hydroxystenozole ({{abbrlink|INN|International Nonproprietary Name}}), also known as 17α-methylandrost-4-eno[3,2-c]pyrazol-17β-ol, is an orally active androgen/anabolic steroid (AAS) and a 17α-alkylated derivative of testosterone that was described in the literature in 1967 but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA668|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=668}} It is closely related to stanozolol (17α-methyl-5α-androstano[3,2-c]pyrazol-17β-ol), differing from it only in hydrogenation (i.e., double bonds and their placement).