hypoglycin B

{{chembox

| Watchedfields = changed

| verifiedrevid = 420135650

| Name = Hypoglycin B

| ImageFile = Hypoglycin B.svg

| ImageSize = 200px

| ImageName = Hypoglycin B

| IUPACName = γ-Glutamyl-3-[(1R-2-methylidenecyclopropyl]alanine

| SystematicName = (2S)-5-({(1S)-1-Carboxy-2-[(1S)-2-methylidenecyclopropyl]ethyl}amino)-5-oxopentanoic acid

| OtherNames = L-γ-Glutamyl-L-hypoglycin; L-γ-Glutamyl-3-[(1S)-2-methylenecyclopropyl]-L-alanine

| Section1 = {{Chembox Identifiers

| SMILES = O=C(N[C@H](C(=O)O)C[C@H]1C(=C)C1)CC[C@@H](C(=O)O)N

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 390178

| PubChem = 441445

| InChI = 1/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-,9-/m0/s1

| InChIKey = UYDZYCPIQSRXKU-CIUDSAMLBD

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H18N2O5/c1-6-4-7(6)5-9(12(18)19)14-10(15)3-2-8(13)11(16)17/h7-9H,1-5,13H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-,9-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UYDZYCPIQSRXKU-CIUDSAMLSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 502-37-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = T83F0X4NGN

| ChEBI = 6332

| KEGG = C08280

| RTECS =

}}

| Section2 = {{Chembox Properties

| C=12|H=18|N=2|O=5

| Density =

| Solubility =

| MeltingPt =

| BoilingPt =

| pKa =

| pKb =

| Viscosity =

}}

| Section3 = {{Chembox Structure

| MolShape =

| Coordination =

| CrystalStruct =

| Dipole =

}}

| Section7 = {{Chembox Hazards

| ExternalMSDS =

| MainHazards =

| FlashPt =

}}

}}

Hypoglycin B is a naturally occurring organic compound in the species Blighia sapida. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is one of the causative agents of Jamaican vomiting sickness.{{cite web | url = http://emedicine.medscape.com/article/1008792-overview | title = Ackee Fruit Toxicity | date = 28 March 2022 | publisher = Medscape}} It is a dipeptide of glutamic acid and hypoglycin A.