icatibant

{{Short description|Pharmaceutical drug}}

{{Use dmy dates|date=April 2020}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 461936569

| image = Icatibant.svg

| width = 300

| alt =

| caption =

| tradename = Firazyr

| Drugs.com = {{drugs.com|monograph|icatibant-acetate}}

| MedlinePlus =

| DailyMedID = Icatibant

| pregnancy_AU = C

| pregnancy_category =

| routes_of_administration = Subcutaneous

| ATC_prefix = B06

| ATC_suffix = AC02

| ATC_supplemental =

| legal_AU = S4

| legal_AU_comment = https://www.tga.gov.au/resources/prescription-medicines-registrations/icatibant-wkt-wockhardt-bio-pty-ltd

| legal_CA =

| legal_UK =

| legal_US = Rx-only

| legal_US_comment =

| legal_EU = Rx-only

| legal_EU_comment =

| legal_status = Rx-only

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| index2_label = as salt

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 130308-48-4

| PubChem = 6918173

| IUPHAR_ligand = 667

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB06196

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16736634

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 68556

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7PG89G35Q7

| KEGG2 = D04492

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1743581

| synonyms = Hoe 140, JE 049{{cite journal | title = Icatibant: HOE 140, JE 049, JE049 | journal = Drugs in R&D | volume = 5 | issue = 6 | pages = 343–8 | year = 2004 | pmid = 15563238 | doi = 10.2165/00126839-200405060-00006 | s2cid = 25491021 }}

| IUPAC_name = (2S)-2-[[(2S,3aS,7aS)-1-[(3R)-2-[(2S)-2-[[(2S)-2-[[2-[[(2S,4R)-1-[(2S)-1-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]-4-hydroxypyrrolidine-2-carbonyl]amino]acetyl]amino]-3-thiophen-2-ylpropanoyl]amino]-3-hydroxypropanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid

| C=59 | H=89 | N=19 | O=13 | S=1

| smiles = C1CC[C@H]2[C@@H](C1)C[C@H](N2C(=O)[C@H]3CC4=CC=CC=C4CN3C(=O)[C@H](CO)NC(=O)[C@H](CC5=CC=CS5)NC(=O)CNC(=O)[C@@H]6C[C@H](CN6C(=O)[C@@H]7CCCN7C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](CCCN=C(N)N)N)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C59H89N19O13S/c60-37(14-5-19-67-57(61)62)48(82)72-38(15-6-20-68-58(63)64)52(86)75-22-8-18-43(75)54(88)77-30-35(80)26-44(77)50(84)70-28-47(81)71-40(27-36-13-9-23-92-36)49(83)74-41(31-79)53(87)76-29-34-12-2-1-10-32(34)24-46(76)55(89)78-42-17-4-3-11-33(42)25-45(78)51(85)73-39(56(90)91)16-7-21-69-59(65)66/h1-2,9-10,12-13,23,33,35,37-46,79-80H,3-8,11,14-22,24-31,60H2,(H,70,84)(H,71,81)(H,72,82)(H,73,85)(H,74,83)(H,90,91)(H4,61,62,67)(H4,63,64,68)(H4,65,66,69)/t33-,35+,37+,38-,39-,40-,41-,42-,43-,44-,45-,46+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QURWXBZNHXJZBE-SKXRKSCCSA-N

}}

Icatibant, sold under the brand name Firazyr, is a medication for the symptomatic treatment of acute attacks of hereditary angioedema (HAE) in adults with C1-esterase-inhibitor deficiency.{{cite press release|title=Jerini Receives European Commission Approval for Firazyr (Icatibant) in the Treatment of HAE |publisher=Jerini AG |date=2008-07-15 |url=http://www.jerini.com/cms/en/05-news-events/05-01-corporate-news/05-01-07-newsarchive-2008/08-07-15_EU_Approval.php?back=true |access-date=2008-07-22 }}{{dead link|date=April 2017 |bot=InternetArchiveBot |fix-attempted=yes }}{{cite web | title=Firazyr- icatibant acetate injection, solution | website=DailyMed | date=16 December 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=ed6657ca-ab68-477a-9968-e12dc928b540 | access-date=17 April 2020}}{{cite web | title=Firazyr EPAR | website=European Medicines Agency (EMA) | date=17 September 2018 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/firazyr | access-date=17 April 2020}} It is not effective in angioedema caused by medication from the ACE inhibitor class.{{cite journal | vauthors = Sinert R, Levy P, Bernstein JA, Body R, Sivilotti ML, Moellman J, Schranz J, Baptista J, Kimura A, Nothaft W | display-authors = 6 | title = Randomized Trial of Icatibant for Angiotensin-Converting Enzyme Inhibitor-Induced Upper Airway Angioedema | journal = The Journal of Allergy and Clinical Immunology. In Practice | volume = 5 | issue = 5 | pages = 1402–1409.e3 | date = September–October 2017 | pmid = 28552382 | doi = 10.1016/j.jaip.2017.03.003 | doi-access = free }}

It is a peptidomimetic consisting of ten amino acids, which is a selective and specific antagonist of bradykinin B2 receptors.

Mechanism of action

Bradykinin is a peptide-based hormone that is formed locally in tissues, very often in response to a trauma. It increases vessel permeability, dilates blood vessels and causes smooth muscle cells to contract. Bradykinin plays an important role as the mediator of pain. Surplus bradykinin is responsible for the typical symptoms of inflammation, such as swelling, redness, overheating and pain. These symptoms are mediated by activation of bradykinin B2 receptors. Icatibant acts as a bradykinin inhibitor by blocking the binding of native bradykinin to the bradykinin B2 receptor. Little is known about the effects of icatibant on the bradykinin B1 receptor.

Society and culture

= Legal status =

Icatibant received orphan drug status in Australia, the EU, Switzerland, and the US for the treatment of hereditary angioedema (HAE).{{cite journal | vauthors = Longhurst HJ | title = Management of acute attacks of hereditary angioedema: potential role of icatibant | journal = Vascular Health and Risk Management | volume = 6 | pages = 795–802 | date = September 2010 | pmid = 20859548 | pmc = 2941790 | doi = 10.2147/vhrm.s4332 | doi-access = free }}

In the EU, the approval by the European Commission (July 2008) allows Jerini to market Firazyr in the European Union's 27 member states, as well as Switzerland, Liechtenstein and Iceland, making it the first product to be approved in all EU countries for the treatment of hereditary angioedema. In the US, the drug was granted FDA approval in August 2011.{{cite press release|url=http://www.shire.com/shireplc/en/media/shirenews?id=520 |title=FDA Approves Shire's Firazyr (icatibant injection) for Acute Attacks of Hereditary Angioedema (HAE) |publisher=Shire |access-date=2011-08-28}}

References

{{Reflist}}

{{Other hematological agents}}

{{Portal bar | Medicine}}

{{Authority control}}

Category:Anti-inflammatory agents

Category:Peptide therapeutics

Category:Orphan drugs

Category:Drugs developed by Takeda Pharmaceutical Company