imazapic

{{Chembox

| Name =

| ImageFile = Imazapic.svg

| ImageSize =

| IUPACName = 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid

| SystematicName = 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 104098-48-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K98N09T10R

| EINECS =

| PubChem = 91770

| ChEBI = 147366

| ChemSpiderID = 82867

| SMILES = O=C(O)c1c(ncc(c1)C)/C2=N/C(C(=O)N2)(C(C)C)C

| InChI = InChI=1S/C14H17N3O3/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)5-8(3)6-15-10/h5-7H,1-4H3,(H,18,19)(H,16,17,20)

| RTECS =

| MeSHName =

| KEGG =

}}

|Section2={{Chembox Properties

| Formula = C14H17N3O3

| MolarMass = 275.303

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

}}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Imazapic is a chemical used as an herbicide. It controls many broad leaf weeds and controls or suppresses some grasses in pasture, rangeland and certain types of turf. It has a half-life of around 120 days in soil.[http://www.invasive.org/gist/products/handbook/16.Imazapic.pdf data pdf sheet]{{Cite web |url=http://toxipedia.org/display/toxipedia/Imazapic |title=toxipedia page |access-date=2011-04-30 |archive-date=2018-05-02 |archive-url=https://web.archive.org/web/20180502053252/http://www.toxipedia.org/display/toxipedia/Imazapic |url-status=dead }} Imazapic is considered an environmental hazard due to its harmful effects on aquatic life.{{Cite web|last=PubChem|title=Imazapic|url=https://pubchem.ncbi.nlm.nih.gov/compound/91770|access-date=2021-11-02|website=pubchem.ncbi.nlm.nih.gov|language=en}}

References