imazapic
{{Chembox
| Name =
| ImageFile = Imazapic.svg
| ImageSize =
| IUPACName = 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid
| SystematicName = 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid
| OtherNames =
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 104098-48-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = K98N09T10R
| EINECS =
| PubChem = 91770
| ChEBI = 147366
| ChemSpiderID = 82867
| SMILES = O=C(O)c1c(ncc(c1)C)/C2=N/C(C(=O)N2)(C(C)C)C
| InChI = InChI=1S/C14H17N3O3/c1-7(2)14(4)13(20)16-11(17-14)10-9(12(18)19)5-8(3)6-15-10/h5-7H,1-4H3,(H,18,19)(H,16,17,20)
| RTECS =
| MeSHName =
| KEGG =
}}
|Section2={{Chembox Properties
| Formula = C14H17N3O3
| MolarMass = 275.303
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
| LogP =
| VaporPressure =
| HenryConstant =
| AtmosphericOHRateConstant =
| pKa =
| pKb =
}}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
}}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity =
}}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US =
}}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor =
}}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| LD50 =
| PEL =
}}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds =
}}
}}
Imazapic is a chemical used as an herbicide. It controls many broad leaf weeds and controls or suppresses some grasses in pasture, rangeland and certain types of turf. It has a half-life of around 120 days in soil.[http://www.invasive.org/gist/products/handbook/16.Imazapic.pdf data pdf sheet]{{Cite web |url=http://toxipedia.org/display/toxipedia/Imazapic |title=toxipedia page |access-date=2011-04-30 |archive-date=2018-05-02 |archive-url=https://web.archive.org/web/20180502053252/http://www.toxipedia.org/display/toxipedia/Imazapic |url-status=dead }} Imazapic is considered an environmental hazard due to its harmful effects on aquatic life.{{Cite web|last=PubChem|title=Imazapic|url=https://pubchem.ncbi.nlm.nih.gov/compound/91770|access-date=2021-11-02|website=pubchem.ncbi.nlm.nih.gov|language=en}}
References
{{reflist}}
{{Herbicides}}