imidazole-1-sulfonyl azide

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 476995490

| ImageFile = Imidazole-1-sulfonyl azide.png

| ImageAlt = Space-filling model of the imidazole-1-sulfonyl azide molecule

| ImageFile1 = Imidazole-1-sulfonyl-azide-3D-spacefill.png

| ImageSize1 = 180

| ImageAlt1 = Space-filling model of the imidazole-1-sulfonyl azide molecule

| PIN = 1H-Imidazole-1-sulfonyl azide

| OtherNames =

|Section1={{Chembox Identifiers

| InChI = 1/C3H3N5O2S.ClH/c4-6-7-11(9,10)8-2-1-5-3-8;/h1-3H;1H

| InChIKey = XYURSCOGYWBRDR-UHFFFAOYAJ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C3H3N5O2S.ClH/c4-6-7-11(9,10)8-2-1-5-3-8;/h1-3H;1H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XYURSCOGYWBRDR-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|PubChem}}

| CASNo = 952234-37-6

| PubChem = 23583981

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=21374920

| SMILES = Cl.O=S(=O)(N=[N+]=[N-])n1ccnc1

}}

|Section2={{Chembox Properties

| C=3 | H=3 | N=5 | O=2 | S=1

| Appearance = Colourless Liquid

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards = Potentially explosive, Harmful

| FlashPt =

| AutoignitionPt =

}}

}}

Imidazole-1-sulfonyl azide is an organic azide compound that can be used as an alternative organic synthesis reagent to trifluoromethanesulfonyl azide. It is an explosive colorless liquid, but some of its organic-soluble salts can be safely handled and stored as a solid.

Preparation

The hydrochloride salt of this compound is also available commercially, but can degrade to release explosive byproducts.{{cite web|last=van Delft|first=Floris|title=SX-B1001|url=http://synaffix.biedmeer.nl/Webwinkel-Category-1120834/SX-B1001.html|work=Synaffix|accessdate=30 January 2014}}

:450px

Reactions

Like trifluoromethanesulfonyl azide, this compound generally converts primary amines or ammonium salts to azides when catalyzed by copper(II), nickel(II), zinc(II), and cobalt(II) salts.{{cite journal | author = E. D. Goddard-Borger and R. V. Stick | title = An Efficient, Inexpensive, and Shelf-Stable Diazotransfer Reagent:  Imidazole-1-sulfonyl Azide Hydrochloride | journal = Organic Letters | volume = 9 | issue = 19 | pages = 3797–3800 | doi = 10.1021/ol701581g | pmid = 17713918 | year = 2007}}

{{cite journal | author = E. D. Goddard-Borger and R. V. Stick | title = An Efficient, Inexpensive, and Shelf-Stable Diazotransfer Reagent:  Imidazole-1-sulfonyl Azide Hydrochloride | journal = Organic Letters | volume = 13 | issue = 9 | pages = 2514 | doi = 10.1021/ol2007555 | year = 2011 | url = https://figshare.com/articles/journal_contribution/2986117 | department = Addition/Correction}} This reaction is effectively the reverse of the Staudinger reaction. Similarly, it is able to transfer the diazo group (=N2) under basic conditions.

Safety

As with all organic azides, this compound is potentially explosive both in use and in preparation. The hydrochloride salt was initially reported to be insensitive to impact, vigorous grinding, and prolonged heating at 80 °C, although heating above 150 °C resulted in violent decomposition. Further reported impact studies indicated otherwise, showing the sensitivity to be similar to RDX. Subsequent reports noted that the hydrochloride salt is hygroscopic, and upon prolonged storage was hydrolyzed to produce hydrazoic acid, which made the material sensitive.{{cite journal | doi = 10.1021/jo202264r | journal = J. Org. Chem. | title = Sensitivities of Some Imidazole-1-sulfonyl Azide Salts | year = 2012 | last1 = Fischer | first1 = Niko | last2 = Goddard-Borger | first2 = Ethan D. | last3 = Greiner | first3 = Robert | last4 = Klapötke | first4 = Thomas M. | last5 = Skelton | first5 = Brian W. | last6 = Stierstorfer | first6 = Jörg | volume = 77 | issue = 4 | pages = 1760–1764| pmid = 22283437 }} Synthesis of the HCl salt has led to a significant explosion, with expected explosive byproducts of sulfonyl diazide or hydrazoic acid being present.{{Cite journal|last1=Goddard-Borger|first1=Ethan D.|last2=Stick|first2=Robert V.|date=2011-03-29|title=An Efficient, Inexpensive, and Shelf-Stable Diazotransfer Reagent: Imidazole-1-sulfonyl Azide Hydrochloride|journal=Organic Letters|language=EN|volume=13|issue=9|pages=2514|doi=10.1021/ol2007555|url=https://figshare.com/articles/journal_contribution/2986117 }}

Recent studies have shown the hydrogen sulfate salt to be significantly less hazardous to handle with decomposition temperature of 131 °C, insensitivity to impact, and low electrostatic discharge and friction sensitivities. Further improvements have led to its synthesis with increased safety, making the hydrogen sulfate salt a relatively safe diazo-transfer reagent to both synthesize and handle.{{Cite journal|last1=Potter|first1=Garrett T.|last2=Jayson|first2=Gordon C.|last3=Miller|first3=Gavin J.|last4=Gardiner|first4=John M.|date=2016-03-29|title=An Updated Synthesis of the Diazo-Transfer Reagent Imidazole-1-sulfonyl Azide Hydrogen Sulfate|journal=The Journal of Organic Chemistry|language=EN|doi=10.1021/acs.joc.6b00177|volume=81|issue=8|pages=3443–3446|pmid=26998999|url=https://www.research.manchester.ac.uk/portal/files/33083992/JOC_note_jo_2016_00177a.pdf|doi-access=free}}

References