indane-5-sulfonamide

{{other uses|Indane (disambiguation)}}

{{Chembox

| ImageFile = Indane-5-sulfonamide.svg

| ImageSize = 150px

| ImageAlt =

| PIN = 2,3-Dihydro-1H-indene-5-sulfonamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 35203-93-1

| CASNo_Ref = {{Cascite|changed|CAS}}

| ChEMBL = 364869

| DrugBank = DB08165

| PubChem = 96876

| EINECS = 252-432-6

| ChemSpiderID = 87470

| UNII = XJL3C99615

| SMILES = c1cc2c(cc1S(=O)(=O)N)CCC2

| StdInChI = 1S/C9H11NO2S/c10-13(11,12)9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3H2,(H2,10,11,12)

| StdInChIKey = XVQJTFMKKZBBSX-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=9 | H=11 | N=1 | O=2 | S=1

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|302|315|319|335}}

| PPhrases = {{P-phrases|261|264|270|271|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Indane-5-sulfonamide is the base structure of indanesulfonamides. Indane-5-sulfonamide is a carbonic anhydrase inhibitor.