indanidine

{{chembox

| Watchedfields = changed

| ImageFile = Indanidine.svg

| PIN = N-(4,5-Dihydro-1H-imidazol-2-yl)-2-methyl-2H-indazol-4-amine

| OtherNames = N-(4,5-Dihydro-1H-imidazol-2-yl)-2-methylindazol-4-amine

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = MP564IFE34

| CASNo = 85392-79-6

| PubChem = 121925

| ChemSpiderID = 108770

| MeSHName = Indanidine

| ChEBI = 345108

| ChEMBL = 358373

| IUPHAR_ligand = 512

| SMILES = CN1C=C2C(C=CC=C2NC2=NCCN2)=N1

| InChI = 1S/C11H13N5/c1-16-7-8-9(3-2-4-10(8)15-16)14-11-12-5-6-13-11/h2-4,7H,5-6H2,1H3,(H2,12,13,14)

| InChIKey = PNHJTLDBYZVCGW-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=11 | H=13 | N=5

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Indanidine is an alpha-adrenergic agonist.{{cite journal | title = Systemic and regional hemodynamic characterization of alpha-1 and alpha-2 adrenoceptor agonists in pithed rats | author = Richer, Christine; Lefevre-Borg, Francoise; Lechaire, Jacqueline; Gomeni, Carla; Gomeni, Robert; Giudicelli, Jean Francois; Cavero, Icilio | journal = Journal of Pharmacology and Experimental Therapeutics | date = 1987 | volume = 240 | issue = 3 | pages = 944–953 | doi = 10.1016/S0022-5347(25)00368-4 }}