indecainide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 461936124

| IUPAC_name = 9-[3-(isopropylamino)propyl]-9H-fluorene-9-carboxamide

| image = Indecainide structure.svg

| image_class = skin-invert-image

| width = 180

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 74517-78-5

| CAS_supplemental =
{{CAS|73681-12-6}} (HCl)

| ATC_prefix = none

| PubChem = 52194

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00192

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 47194

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3AZF20DM1T

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04521

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201242

| C=20 | H=24 | N=2 | O=1

| smiles = O=C(N)C3(c1ccccc1c2c3cccc2)CCCNC(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H24N2O/c1-14(2)22-13-7-12-20(19(21)23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20/h3-6,8-11,14,22H,7,12-13H2,1-2H3,(H2,21,23)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UCEWGESNIULAGX-UHFFFAOYSA-N

}}

Indecainide (INN, trade name Decabid) is a class Ic antiarrhythmic agent.{{cite journal | vauthors = Jaillon P, Drici M | title = Recent antiarrhythmic drugs | journal = The American Journal of Cardiology | volume = 64 | issue = 20 | pages = 65J–69J | date = December 1989 | pmid = 2688391 | doi = 10.1016/0002-9149(89)91203-4 }} Developed and marketed by Lilly, it has now been discontinued.