indisetron
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = Indisetron.svg
| alt =
| caption =
| pronounce =
| tradename = Sinseron
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration =
| ATCvet =
| ATC_prefix = none
| ATC_suffix =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Rx in Japan
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| CAS_number = 141549-75-9
| PubChem = 178039
| DrugBank =
| UNII = 89RBZ66NVC
| ChEBI = 135344
| ChEMBL = 2104994
| ChemSpiderID = 2302029
| KEGG = D02632
| synonyms = N-3389
| smiles = CN1C[C@H]2CC(C[C@@H](C1)N2C)NC(=O)C3=NNC4=CC=CC=C43
| StdInChIKey = MHNNVDILNTUWNS-YHWZYXNKSA-N
| StdInChI = 1S/C17H23N5O/c1-21-9-12-7-11(8-13(10-21)22(12)2)18-17(23)16-14-5-3-4-6-15(14)19-20-16/h3-6,11-13H,7-10H2,1-2H3,(H,18,23)(H,19,20)/t11?,12-,13+
| IUPAC_name = N-[(1R,5S)-3,9-Dimethyl-3,9-diazabicyclo[3.3.1]nonan-7-yl]-1H-indazole-3-carboxamide
| C=17 | H=23 | N=5 | O=1
}}
Indisetron (INN; trade name Sinseron) is a drug used for prophylaxis of chemotherapy-induced nausea and vomiting. It was approved by Japan's Pharmaceuticals and Medical Devices Agency in 2004.
Indisetron exerts its effects as a dual serotonin 5-HT3 and 5-HT4 receptor antagonist.{{cite web | url = https://drugs.ncats.io/drug/89RBZ66NVC | title = Indisetron | work = Inxight: Drugs | publisher = National Center for Advancing Translational Sciences, National Institutes of Health }}{{cite journal | vauthors = Tsukagoshi S | title = [Introduction of novel anti-emetic agent, indisetron hydrochloride, developed recently in Japan] | language = Japanese | journal = Gan to Kagaku Ryoho. Cancer & Chemotherapy | volume = 32 | issue = 4 | pages = 567–73 | date = April 2005 | pmid = 15853230 | doi = | url = }}