indoprofen

{{Short description|Withdrawn NSAID drug}}

{{Drugbox

| IUPAC_name = 2-[4-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)
phenyl]propanoic acid

| image = Indoprofen.svg

| image_class = skin-invert-image

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Withdrawn

| routes_of_administration = Oral

| bioavailability = High (rapid and complete absorption)

| protein_bound =

| metabolism = Glucuronidation

| elimination_half-life = 2.3 hours

| excretion = Renal

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 31842-01-0

| ATC_prefix = M01

| ATC_suffix = AE10

| PubChem = 3718

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08951

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3587

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CPE46ZU14N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04530

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 76162

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 15870

| C=17 | H=15 | N=1 | O=3

| smiles = O=C(O)C(c1ccc(cc1)N3C(=O)c2ccccc2C3)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H15NO3/c1-11(17(20)21)12-6-8-14(9-7-12)18-10-13-4-2-3-5-15(13)16(18)19/h2-9,11H,10H2,1H3,(H,20,21)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RJMIEHBSYVWVIN-UHFFFAOYSA-N

}}

Indoprofen is a nonsteroidal anti-inflammatory drug (NSAID). It was withdrawn worldwide in the 1980s after postmarketing reports of severe gastrointestinal bleeding.{{cite web | url = http://www.ninds.nih.gov/news_and_events/news_articles/news_article_SMA_indoprofen.htm | last = Frazin | first = Natalie | name-list-style = vanc | title = Pain Reliever May Provide Clues for Treating Spinal Muscular Atrophy | date = March 9, 2005 | access-date = 2007-10-06 | publisher = United States National Institute of Neurological Disorders and Stroke | archive-date = 2008-07-04 | archive-url = https://web.archive.org/web/20080704145021/http://www.ninds.nih.gov/news_and_events/news_articles/news_article_SMA_indoprofen.htm | url-status = dead }}

A 2004 study using high-throughput screening found indoprofen to increase production of the survival of motor neuron protein, suggesting it may provide insight into treatments for spinal muscular atrophies.{{cite journal | vauthors = Lunn MR, Root DE, Martino AM, Flaherty SP, Kelley BP, Coovert DD, Burghes AH, Man NT, Morris GE, Zhou J, Androphy EJ, Sumner CJ, Stockwell BR | display-authors = 6 | title = Indoprofen upregulates the survival motor neuron protein through a cyclooxygenase-independent mechanism | journal = Chemistry & Biology | volume = 11 | issue = 11 | pages = 1489–93 | date = November 2004 | pmid = 15555999 | pmc = 3160629 | doi = 10.1016/j.chembiol.2004.08.024 }}