indoramin

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-{1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl}benzamide

| image = Indoramin.svg

| tradename =

| Drugs.com = {{drugs.com|international|indoramin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 26844-12-2

| ATC_prefix = C02

| ATC_suffix = CA02

| PubChem = 33625

| IUPHAR_ligand = 501

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB08950

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 31014

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0Z802HMY7H

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04531

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 279516

| C=22 | H=25 | N=3 | O=1

| smiles = O=C(c1ccccc1)NC4CCN(CCc3c2ccccc2[nH]c3)CC4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H25N3O/c26-22(17-6-2-1-3-7-17)24-19-11-14-25(15-12-19)13-10-18-16-23-21-9-5-4-8-20(18)21/h1-9,16,19,23H,10-15H2,(H,24,26)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JXZZEXZZKAWDSP-UHFFFAOYSA-N

}}

Indoramin (trade names Baratol and Doralese) is a piperidine antiadrenergic agent.

It is an alpha-1 selective adrenoceptor antagonist{{cite journal | vauthors = Pierce V, Shepperson NB, Todd MH, Waterfall JF | title = Investigation into the cardioregulatory properties of the alpha 1-adrenoceptor blocker indoramin | journal = British Journal of Pharmacology | volume = 87 | issue = 2 | pages = 433–441 | date = February 1986 | pmid = 3955309 | pmc = 1916533 | doi = 10.1111/j.1476-5381.1986.tb10834.x }} with direct myocardial depression action; therefore, it results in no reflex tachycardia. It is also used in benign prostatic hyperplasia (BPH).{{cite web|url=http://www.medicines.org.uk/Guides/indoramin%20hydrochloride/prostatic%20hyperplasia%20(benign)|title=Indoramin 20mg tablets|publisher=Medicines.org.uk|date=April 20, 2011|access-date=September 30, 2012|archive-date=July 25, 2022|archive-url=https://web.archive.org/web/20220725151921/https://www.medicines.org.uk/Guides/indoramin%20hydrochloride/prostatic%20hyperplasia%20(benign)|url-status=dead}}

It is commonly synthesized from tryptophol.Ullman's encyclopedia of Industrial Chemistry, Sixth Edition, 2002.