iobenzamic acid

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-[1-(3-amino-2,4,6-triiodophenyl)-N-phenylformamido]propanoic acid

| image = Iobenzamic acid.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 3115-05-7

| ATC_prefix = V08

| ATC_suffix = AC05

| PubChem = 18377

| DrugBank = DB13428

| ChemSpiderID = 17355

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F72UWG2SWK

| KEGG = D01313

| C=16 | H=13 | I=3 | N=2 | O=3

| smiles = Ic1c(c(I)c(N)c(I)c1)C(=O)N(c2ccccc2)CCC(=O)O

| StdInChI=1S/C16H13I3N2O3/c17-10-8-11(18)15(20)14(19)13(10)16(24)21(7-6-12(22)23)9-4-2-1-3-5-9/h1-5,8H,6-7,20H2,(H,22,23)

| StdInChIKey = FJYJNLIEGUTPIJ-UHFFFAOYSA-N

}}

Iobenzamic acid is a pharmaceutical drug used as an X-ray contrast agent.{{DrugBank|DB13428}}. Accessed 2021-03-18.

It is a water-soluble, hepatotropic contrast medium, meaning it is taken up by the liver and gallbladder. This makes it useful for imaging these organs.{{cite web

|url=https://pubchem.ncbi.nlm.nih.gov/compound/Iobenzamic_acid#section=MeSH-Pharmacological-Classification

|title=Iobenzamic acid - PubChem Compound Summary

|website=PubChem

|access-date=July 18, 2023

}}