iocetamic acid

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-[N-(3-amino-2,4,6-triiodophenyl)acetamido]-2-methylpropanoic acid

| image = Iocetamic acid.png

| tradename = Cholebrin

| Drugs.com =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 16034-77-8

| ATC_prefix = V08

| ATC_suffix = AC07

| PubChem = 27648

| DrugBank = DB09403

| ChemSpiderID = 25724

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FA675Q0E3E

| KEGG = D04563

| ChEMBL = 1200770

| C=12 | H=13 | I=3 | N=2 | O=3

| smiles = O=C(O)C(CN(C(=O)C)c1c(I)cc(I)c(c1I)N)C

}}

Iocetamic acid (trade name Cholebrin) is a pharmaceutical drug taken by mouth and used as an iodinated contrast medium for X-ray imaging of the gall bladder.{{cite journal | vauthors = Fielding JA, Whitehouse GH | title = A comparative trial of two oral cholecystographic contrast media--iocetamic acid (Cholebrin) and iopanoic acid (Telepaque) | journal = Clinical Radiology | volume = 30 | issue = 1 | pages = 45–8 | date = January 1979 | pmid = 154372 | doi = 10.1016/s0009-9260(79)80041-0 }}

It is not known to be marketed anywhere in the world in 2021.{{cite web|url=https://www.drugs.com/ingredient/iocetamic-acid.html|title=Iocetamic acid|website=Drugs.com|access-date=2021-03-25}}