iodamide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407428110

| IUPAC_name = 3-Acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoic acid

| image = Iodamide.png

| alt = Skeletal formula of iodamide

| image2 = Iodamide-3D-spacefill.png

| alt2 = Space-filling model of the iodamide molecule

| width2 = 200

| tradename = Renovue

| Drugs.com = {{drugs.com|international|iodamide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 440-58-4

| ATC_prefix = V08

| ATC_suffix = AA03

| PubChem = 3723

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB08948

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 4RII332O0R

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01376

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201239

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3592

| C=12 | H=11 | I=3 | N=2 | O=4

| smiles = CC(=O)NCC1=C(C(=C(C(=C1I)NC(=O)C)I)C(=O)O)I

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H11I3N2O4/c1-4(18)16-3-6-8(13)7(12(20)21)10(15)11(9(6)14)17-5(2)19/h3H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VVDGWALACJEJKG-UHFFFAOYSA-N

}}

Iodamide (trade name Renovue) is a pharmaceutical drug used as an iodinated contrast medium for X-ray imaging. Its uses include imaging of the uterus and fallopian tubes.{{cite journal | vauthors = Rosenfield AT, Putman CE, Ulreich S, Koss N | title = Double-blind comparison of iodamide and diatrizoate for excretory urography | journal = The Yale Journal of Biology and Medicine | volume = 50 | issue = 6 | pages = 631–6 | year = 1977 | pmid = 345632 | pmc = 2595582 }}{{cite journal | vauthors = Mohd Nor H, Jayapragasam K, Abdullah B | title = Diagnostic image quality of hysterosalpingography: ionic versus non ionic water soluble iodinated contrast media | journal = Biomedical Imaging and Intervention Journal | volume = 5 | issue = 3 | pages = e29 | date = July 2009 | pmid = 21611058 | pmc = 3097785 | doi = 10.2349/biij.5.3.e29 }}