ioglycamic acid

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 3-(2-{[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]methoxy}acetamido)-2,4,6-triiodobenzoic acid

| image = Ioglycamic acid.png

| tradename = Biligram

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 2618-25-9

| ATC_prefix = V08

| ATC_suffix = AC03

| PubChem = 17477

| DrugBank = DB13741

| ChemSpiderID = 16526

| ChEMBL = 2106372

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ET36GPP4T7

| C=18 | H=10 | I=6 | N=2 | O=7

| smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)COCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I

}}

Ioglycamic acid (trade name Biligram) is a pharmaceutical drug that was used as an iodinated contrast medium for X-ray imaging of the gall bladder.{{cite journal | vauthors = Taenzer V, Volkhardt V | title = Double blind comparison of meglumine iotroxate (Biliscopin), meglumine iodoxamate (Endobil), and meglumine ioglycamate (Biligram) | journal = AJR. American Journal of Roentgenology | volume = 132 | issue = 1 | pages = 55–8 | date = January 1979 | pmid = 103404 | doi = 10.2214/ajr.132.1.55 }}

References