ioglycamic acid
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 3-(2-
| image = Ioglycamic acid.png
| tradename = Biligram
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 2618-25-9
| ATC_prefix = V08
| ATC_suffix = AC03
| PubChem = 17477
| DrugBank = DB13741
| ChemSpiderID = 16526
| ChEMBL = 2106372
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ET36GPP4T7
| C=18 | H=10 | I=6 | N=2 | O=7
| smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)COCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I
}}
Ioglycamic acid (trade name Biligram) is a pharmaceutical drug that was used as an iodinated contrast medium for X-ray imaging of the gall bladder.{{cite journal | vauthors = Taenzer V, Volkhardt V | title = Double blind comparison of meglumine iotroxate (Biliscopin), meglumine iodoxamate (Endobil), and meglumine ioglycamate (Biligram) | journal = AJR. American Journal of Roentgenology | volume = 132 | issue = 1 | pages = 55–8 | date = January 1979 | pmid = 103404 | doi = 10.2214/ajr.132.1.55 }}