iomeprol

{{Short description|Chemical compound}}

{{Use dmy dates|date=November 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Iomeprol-Structural Formula V.1.svg

| width =

| alt =

| caption =

| pronounce =

| tradename = Iomervu, others

| Drugs.com =

| MedlinePlus =

| DailyMedID = Iomeprol

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = Intravenous, intra-arterial

| class =

| ATC_prefix = V08

| ATC_suffix = AB10

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = [https://web.archive.org/web/20241204060629/https://www.accessdata.fda.gov/drugsatfda_docs/label/2024/216017s000,216017s000lbl.pdf fda.gov]

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx-only

| bioavailability =

| protein_bound =

| metabolism = none

| metabolites =

| onset =

| elimination_half-life = 109±20 min

| duration_of_action =

| excretion = Kidney

| CAS_number = 78649-41-9

| PubChem = 3731

| IUPHAR_ligand =

| DrugBank = DB11705

| ChemSpiderID = 3600

| UNII = 17E17JBP8L

| KEGG = D01719

| ChEBI = 31710

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 1-N,3-N-bis(2,3-dihydroxypropyl)-5-(2-hydroxy-N-methylacetamido)-2,4,6-triiodobenzene-1,3-dicarboxamide

| C=17 | H=22 | I=3 | N=3 | O=8

| SMILES = Ic1c(c(I)c(c(I)c1N(C(=O)CO)C)C(=O)NCC(O)CO)C(=O)NCC(O)CO

| StdInChI = 1S/C17H22I3N3O8/c1-23(9(29)6-26)15-13(19)10(16(30)21-2-7(27)4-24)12(18)11(14(15)20)17(31)22-3-8(28)5-25/h7-8,24-28H,2-6H2,1H3,(H,21,30)(H,22,31)

| StdInChI_comment =

| StdInChIKey = NJKDOADNQSYQEV-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Iomeprol, sold under the brand name Imeron among others, is a medication used as a radiocontrast agent in X-ray imaging.{{cite book | vauthors = Rossiter D |title=South African medicines formulary |date=2014 |publisher=Health and Medical Pub. Group .of the South African Medical Association |location=Rondebosch, South Africa |isbn=978-1-875098-30-9 |edition=11th |oclc=869772940}}{{cite book|title=Austria-Codex| veditors = Haberfeld H |at=Iomeron 300 mg J/ml-Infusionsflasche|publisher=Österreichischer Apothekerverlag|location=Vienna|year=2020|language=German}}

Iomeprol was approved for medical use in the United States in November 2024.{{cite web | title=Novel Drug Approvals for 2024 | website=U.S. Food and Drug Administration (FDA) | date=1 October 2024 | url=https://www.fda.gov/drugs/novel-drug-approvals-fda/novel-drug-approvals-2024 | access-date=29 November 2024}}{{cite report | title=New Drug Therapy Approvals 2024 | website=U.S. Food and Drug Administration (FDA) | date=January 2025 | url=https://www.fda.gov/media/184967/download | format=PDF | access-date=21 January 2025 | archive-url=https://web.archive.org/web/20250121045744/https://www.fda.gov/media/184967/download | archive-date=21 January 2025 | url-status=live }}