iotalamic acid

{{short description|Chemical compound}}

{{Use dmy dates|date=February 2022}}

{{Infobox drug

| type =

| image = Iotalamic acid.png

| width = 200

| alt = Skeletal formula of iotalamic acid

| image2 = Iotalamic-acid-3D-spacefill.png

| width2 = 180

| alt2 = Space-filling model of the iotalamic acid molecule

| caption =

| USAN = Iothalamic acid

| pronounce =

| tradename = Conray, Glofil-125, Cysto-Conray II, others

| Drugs.com = {{drugs.com|cdi|iothalamate-meglumine}}

| MedlinePlus =

| licence_EU =

| DailyMedID = Iothalamate

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration = Intravascular

| class =

| ATCvet =

| ATC_prefix = V08

| ATC_suffix = AA04

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Conray- iothalamate meglumine injection | website=DailyMed | date=1 January 2021 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=1292abfc-496f-4df7-9a08-72072953e1f1 | access-date=23 February 2022}}{{cite web | title=Glofil-125- sodium iothalamate i-125 injection injection, solution | website=DailyMed | date=9 December 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=7f250086-2837-484b-9674-e09856b34cb0 | access-date=23 February 2022}}{{cite web | title=Cysto-Conray II- iothalamate meglumine injection | website=DailyMed | date=31 December 2020 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=8841ab4d-674d-4beb-88a5-13e35f6005cc | access-date=23 February 2022}}

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 2276-90-6

| CAS_supplemental =

| PubChem = 3737

| IUPHAR_ligand =

| DrugBank = DB09133

| ChemSpiderID = 3606

| UNII = 16CHD79MIX

| KEGG = D01258

| ChEBI = 31713

| ChEMBL = 1201300

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = MI-216, iothalamate meglumine

| IUPAC_name = 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid

| C=11 | H=9 | I=3 | N=2 | O=4

| SMILES = CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)C(=O)NC)I

| StdInChI = 1S/C11H9I3N2O4/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20/h1-2H3,(H,15,18)(H,16,17)(H,19,20)

| StdInChI_comment =

| StdInChIKey = UXIGWFXRQKWHHA-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Iotalamic acid, sold under the brand name Conray, is an iodine-containing radiocontrast agent. It is available in form of its salts, sodium iotalamate and meglumine iotalamate. It can be given intravenously or intravesically (into the urinary bladder).

A radioactive formulation is also available as sodium iothalamate I-125 injection (brand name Glofil-125). It is indicated for evaluation of glomerular filtration in the diagnosis or monitoring of people with kidney disease.