ioversol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407439500

| image = Ioversol.png

| alt =

| tradename = Optiray

| Drugs.com = {{drugs.com|MTM|ioversol}}

| pregnancy_AU = B1

| pregnancy_category =

| routes_of_administration =

| ATC_prefix = V08

| ATC_suffix = AB07

| legal_AU = Unscheduled

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| bioavailability =

| protein_bound = Low

| metabolism = None

| elimination_half-life = 90 min

| excretion = Kidneys

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 87771-40-2

| PubChem = 3741

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB09134

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = N3RIB7X24K

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01555

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200614

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 3610

| IUPAC_name = 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[2-hydroxy-N-(2-hydroxyethyl)acetamido]-2,4,6-triiodobenzene-1,3-dicarboxamide

| C=18 | H=24 | I=3 | N=3 | O=9

| smiles = C(CO)N(C1=C(C(=C(C(=C1I)C(=O)NCC(CO)O)I)C(=O)NCC(CO)O)I)C(=O)CO

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H24I3N3O9/c19-13-11(17(32)22-3-8(29)5-26)14(20)16(24(1-2-25)10(31)7-28)15(21)12(13)18(33)23-4-9(30)6-27/h8-9,25-30H,1-7H2,(H,22,32)(H,23,33)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AMDBBAQNWSUWGN-UHFFFAOYSA-N

}}

Ioversol (INN; trade name Optiray) is an organoiodine compound that is used as a contrast medium. It features both a high iodine content, as well as several hydrophilic groups. It is used in clinical diagnostics including arthrography, angiocardiography and urography.{{cite web |title=Optiray (ioversol) dosing, indications, interactions, adverse effects, and more |url=https://reference.medscape.com/drug/optiray-ioversol-343759#0 |website=reference.medscape.com |access-date=9 January 2021}}{{cite book | vauthors = Chen Y, Huang X, Huang S, Matchett M | veditors = Wang PG, He W |title=Hydrophilic Interaction Liquid Chromatography (HILIC) and Advanced Applications |publisher=CRC Press |isbn=978-1-4398-0753-8 |page=295-30 |chapter-url= https://books.google.com/books?id=psoSZYLnGkcC&dq=ioversol&pg=PA295 |language=en |chapter=13. Fast-in-process method for the determination ioversol and related polar compounds by hydrophilic interactive chromatography| date = 17 February 2011 }}