ioxilan

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 461935346

| IUPAC_name = 1-N-(2,3-dihydroxypropyl)-5-[N-(2,3-dihydroxypropyl)acetamido]-3-N-(2-hydroxyethyl)-2,4,6-triiodobenzene-1,3-dicarboxamide

| image = Ioxilan structure.png

| tradename = Oxilan

| Drugs.com = {{drugs.com|pro|oxilan}}

| pregnancy_AU =

| pregnancy_US = B

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Rx-only

| legal_status = Discontinued

| routes_of_administration = intravenously

| bioavailability = N/A

| protein_bound = negligible

| metabolism = none

| elimination_half-life = 2 hours

| excretion = Mostly renal

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 107793-72-6

| ATC_prefix = V08

| ATC_suffix = AB12

| PubChem = 3743

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB09135

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3612

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A4YJ7J11TG

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02161

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201075

| C=18 | H=24 | I=3 | N=3 | O=8

| smiles = O=C(N(c1c(I)c(c(I)c(c1I)C(=O)NCCO)C(=O)NCC(O)CO)CC(O)CO)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H24I3N3O8/c1-8(28)24(5-10(30)7-27)16-14(20)11(17(31)22-2-3-25)13(19)12(15(16)21)18(32)23-4-9(29)6-26/h9-10,25-27,29-30H,2-7H2,1H3,(H,22,31)(H,23,32)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UUMLTINZBQPNGF-UHFFFAOYSA-N

}}

Ioxilan is a diagnostic contrast agent.{{cite book | vauthors = Cheng KT | chapter = Ioxilan carbonate particles | title = Molecular Imaging and Contrast Agent Database (MICAD) [Internet] | location = Bethesda (MD) | publisher = National Center for Biotechnology Information (US) | date = December 2007 | pmid = 20641969 | doi = | chapter-url = https://www.ncbi.nlm.nih.gov/books/NBK25587/ }} It is injected intravenously before taking X-ray images to increase arterial contrast in the final image. It was marketed in the US under the trade name Oxilan by Guerbet, L.L.C., but was discontinued in 2017.Oxilan {{drugs.com|pro|oxilan}}. Accessed 2021-04-07.