iron(II) acetate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 446429319

| Name = Iron(II) acetate

| ImageFile = Iron(II) acetate.png

| ImageSize = 150px

| ImageName = Skeletal formula of iron(II) acetate

| IUPACName = Iron(II) acetate

| OtherNames = Ferrous acetate

|Section1={{Chembox Identifiers

| SMILES = CC(O1)O[Fe]12OC(O2)C

| SMILES_Comment = coordination form

| SMILES1 = CC(=O)[O-].[Fe+2].CC(=O)[O-]

| SMILES1_Comment = ionic form

| ChemSpiderID = 17323

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| PubChem = 18344

| InChI = 1/2C2H4O2.Fe/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| InChIKey = LNOZJRCUHSPCDZ-NUQVWONBAS

| StdInChI = 1S/2C2H4O2.Fe/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LNOZJRCUHSPCDZ-UHFFFAOYSA-L

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| CASNo = 3094-87-9

| CASNo2 = 19807-28-4

| CASNo2_Comment = tetrahydrate

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L80I7M6D3Q

| RTECS = AI3850000

}}

|Section2={{Chembox Properties

| C=4 | H=6 | Fe=1 | O=4

| Appearance = White crystals (anhydrous)
Light green crystals (tetrahydrate)

| Odor = Odorless

| Density = 1.734 g/cm³ (−73 °C)

| Solubility = Soluble{{CRC90}}

| SolubleOther =

| MeltingPtC = 190-200

| MeltingPt_notes =
decomposes

| MagSus =

}}

|Section3={{Chembox Structure

| CrystalStruct = Orthorhombic, oP75 (200 K)

| SpaceGroup = Pbcn, No. 60 (200 K)

| PointGroup = 2/m 2/m 2/m (200 K)

| LattConst_a = 18.1715(4) Å

| LattConst_b = 22.1453(5) Å

| LattConst_c = 8.2781(2) Å (200 K)

| LattConst_alpha = 90

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS07}}{{Sigma-Aldrich|id=517933|name=Iron(II) acetate|accessdate=2014-05-03}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|305+351+338}}

| NFPA-H = 2

| NFPA-F = 0

| NFPA-R = 0

| NFPA_ref = {{cite web|title = MSDS of Ferrous acetate |url = https://www.fishersci.ca/viewmsds.do?catNo=AC305370500 |website=fishersci.ca |publisher = Fisher Scientific |place = Fair Lawn|access-date = 2014-08-02}}

}}

}}

Iron(II) acetate describes compounds with formula {{chem2|Fe(CH3CO2)2*(H2O)_{x}|}} where x can be 0 (anhydrous) or 4 (tetrahydrate). The anhydrous compound is a white solid, although impure samples can be slightly colored.{{cite journal |doi=10.1002/zaac.201000274|title=Crystal Structure of Iron(II) Acetate|year=2011|last1= Weber|first1=Birgit|last2=Betz|first2=Richard|last3=Bauer|first3 =Wolfgang|last4=Schlamp|first4=Stephan|journal=Zeitschrift für anorganische und allgemeine Chemie|volume=637|pages=102–107}} The tetrahydrate is light green solid that is highly soluble in water.