iscotrizinol

{{chembox

| Verifiedfields = changed

| verifiedrevid = 443881587

| ImageFile = Iscotrizinol structure.svg

| ImageSize = 300px

| PIN = Bis(2-ethylhexyl) 4,4′-[(6-{[4-(tert-butylcarbamoyl)phenyl]amino}-1,3,5-triazine-2,4-diyl)bis(azanediyl)]dibenzoate

| OtherNames = Diethylhexyl butamido triazone (INCI),
Uvasorb HEB (trade name)

|Section1={{Chembox Identifiers

| Abbreviations =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 7986571

| InChI1 = 1/C44H59N7O5/c1-8-12-14-30(10-3)28-55-39(53)33-18-24-36(25-19-33)46-42-48-41(45-35-22-16-32(17-23-35)38(52)51-44(5,6)7)49-43(50-42)47-37-26-20-34(21-27-37)40(54)56-29-31(11-4)15-13-9-2/h16-27,30-31H,8-15,28-29H2,1-7H3,(H,51,52)(H3,45,46,47,48,49,50)

| InChIKey1 = OSCJHTSDLYVCQC-UHFFFAOYAP

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C44H59N7O5/c1-8-12-14-30(10-3)28-55-39(53)33-18-24-36(25-19-33)46-42-48-41(45-35-22-16-32(17-23-35)38(52)51-44(5,6)7)49-43(50-42)47-37-26-20-34(21-27-37)40(54)56-29-31(11-4)15-13-9-2/h16-27,30-31H,8-15,28-29H2,1-7H3,(H,51,52)(H3,45,46,47,48,49,50)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OSCJHTSDLYVCQC-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 154702-15-5

| EINECS =

| PubChem = 9810816

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2UTZ0QC864

| SMILES = O=C(OCC(CC)CCCC)c1ccc(cc1)Nc2nc(nc(n2)Nc3ccc(C(=O)OCC(CC)CCCC)cc3)Nc4ccc(C(=O)NC(C)(C)C)cc4

| InChI = 1/C44H59N7O5/c1-8-12-14-30(10-3)28-55-39(53)33-18-24-36(25-19-33)46-42-48-41(45-35-22-16-32(17-23-35)38(52)51-44(5,6)7)49-43(50-42)47-37-26-20-34(21-27-37)40(54)56-29-31(11-4)15-13-9-2/h16-27,30-31H,8-15,28-29H2,1-7H3,(H,51,52)(H3,45,46,47,48,49,50)/f/h45-47,51H

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D09714

}}

|Section2={{Chembox Properties

| C=44 | H=59 | N=7 | O=5

| MolarMass = 765.981

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

}}

Iscotrizinol (USAN,[https://searchusan.ama-assn.org/undefined/documentDownload?uri=%2Funstructured%2Fbinary%2Fusan%2Fiscotrizinol.pdf Statement on a nonproprietary name adopted by the USAN Council] INCI diethylhexyl butamido triazone) is an organic compound used in sunscreens to absorb UVB and some UVA radiation [http://incidecoder.com/ingredients/diethylhexyl-butamido-triazone incidecoder.com: Diethylhexyl Butamido Triazone] with a peak protection at 310 nm.{{cite journal

| title = Study of the efficacy of 18 sun filters authorized in European Union tested in vitro.

| date = June 2007

| vauthors = Couteau C, Pommier M, Paparis E, Coiffard LJ

| journal = Pharmazie| volume=62 | issue = 6

| pages=449–452

| pmid = 17663193

| doi = 10.1691/ph.2007.6.6247}} It is one of the most photostable chemical sunscreens known today with 25 hours required to lose 10% of its SPF protection ability.{{cite journal

| title = Study of the photostability of 18 sunscreens in creams by measuring the SPF in vitro

| date = May 2007

| vauthors = Couteau C, Faure A, Fortin J, Paparis E, Coiffard LJ

| journal = Journal of Pharmaceutical and Biomedical Analysis| volume=44 | issue = 1

| pages= 270–273

| doi = 10.1016/j.jpba.2007.01.052| pmid = 17367977

}} It is marketed as Uvasorb HEB by 3V Sigma.

References