isoconazole

{{Short description|Chemical compound}}

{{Infobox drug

|IUPAC_name = (RS)-1-[2-[(2,6-Dichlorobenzyl)oxy]-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole

|image=Isoconazole.svg

|tradename =

|Drugs.com = {{drugs.com|international|isoconazole}}

|pregnancy_AU =

|pregnancy_category =

|legal_AU =

|legal_CA =

|legal_UK =

|legal_US =

|legal_status =

|routes_of_administration =

|bioavailability =

|protein_bound =

|metabolism =

|elimination_half-life =

|excretion =

|CAS_number = 27523-40-6

|ATC_prefix = D01

|ATC_suffix = AC05

|ATC_supplemental = {{ATC|G01|AF07}}

|PubChem = 3760

|DrugBank_Ref = {{drugbankcite|changed|drugbank}}

|DrugBank = DB08943

|ChEMBL = 1571863

|ChemSpiderID = 3629

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = GRI7WFR424

|KEGG = D04624

|ChEBI_Ref = {{ebicite|correct|EBI}}

|ChEBI = 82865

|C=18 |H=14 |Cl=4 |N=2 |O=1

|smiles=Clc1ccc(c(Cl)c1)C(OCc2c(Cl)cccc2Cl)Cn3ccnc3

}}

Isoconazole is an azole antifungal drug and could inhibit gram positive bacteria.{{cite journal | vauthors = Veraldi S | title = Isoconazole nitrate: a unique broad-spectrum antimicrobial azole effective in the treatment of dermatomycoses, both as monotherapy and in combination with corticosteroids | journal = Mycoses | volume = 56 | issue = Suppl 1 | pages = 3–15 | date = May 2013 | pmid = 23574019 | doi = 10.1111/myc.12054 | s2cid = 1881151 }}{{cite book |title=The Merck Index |chapter=Isoconazole |edition=12th |page=5176 | isbn = 0-911910-12-3 | veditors = Budavari S | date = 1996 | vauthors = Budavari S, O'Neil M, Smith A, Heckelman P, Obenchain J }} For foot and vaginal infections, isoconazole has a similar effectiveness to clotrimazole.{{cite journal | vauthors = Oyeka CA, Gugnani HC | title = Isoconazole nitrate versus clotrimazole in foot and nail infections due to Hendersonula toruloidea, Scytalidium hyalinum and dermatophytes | journal = Mycoses | volume = 35 | issue = 11–12 | pages = 357–361 | year = 1992 | pmid = 1302811 | doi = 10.1111/j.1439-0507.1992.tb00894.x | s2cid = 6764090 }}{{cite journal | vauthors = Cohen L | title = Single dose treatment of vaginal candidosis: comparison of clotrimazole and isoconazole | journal = The British Journal of Venereal Diseases | volume = 60 | issue = 1 | pages = 42–44 | date = February 1984 | pmid = 6365236 | pmc = 1046268 | doi = 10.1136/sti.60.1.42 }} Isoconazole nitrate may be used in combination with corticosteroid diflucortolone to increase its bioavailability.

It was patented in 1968 and approved for medical use in 1979.{{cite book | vauthors = Fischer J, Ganellin CR |author-link2=C. Robin Ganellin |date=2006 |title=Analogue-based Drug Discovery |language=en |publisher=John Wiley & Sons |isbn=9783527607495 |page=502 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA502}}