isodesmosine

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424832042

| ImageFile = isodesmosine.svg

| ImageSize =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 991-01-5

| EINECS =

| PubChem = 13811

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 13214

| SMILES = c1c(c[n+](c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N

| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1

| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O

| RTECS =

| MeSHName = D007524

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 64366

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=24

| H=40

| N=5

| O=8

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb =

| IsoelectricPt =

| LambdaMax =

| Absorbance =

| SpecRotation =

| RefractIndex =

| Viscosity =

| Dipole = }}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

| Dipole = }}

|Section4={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US = }}

|Section6={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = }}

}}

Isodesmosine is a lysine derivative found in elastin. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by lysyl-oxidase. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.{{cite journal | doi = 10.1016/j.matbio.2006.09.011 | pmid = 17112714 | title = Differential expression of two tropoelastin genes in zebrafish | journal = Matrix Biology | volume = 26 | issue = 2 | pages = 115–124 | year = 2007 | last1 = Miao | first1 = M. | last2 = Bruce | first2 = A.E.E. | last3 = Bhanji | first3 = T. | last4 = Davis | first4 = E.C. | last5 = Keeley | first5 = F.W. }}

See also

References

{{reflist}}

Category:Alpha-Amino acids

{{Biochemistry-stub}}