isodesmosine
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424832042
| ImageFile = isodesmosine.svg
| ImageSize =
| IUPACName =
| OtherNames =
|Section1={{Chembox Identifiers
| Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 991-01-5
| EINECS =
| PubChem = 13811
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 13214
| SMILES = c1c(c[n+](c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N
| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O
| RTECS =
| MeSHName = D007524
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 64366
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
}}
|Section2={{Chembox Properties
| C=24
| H=40
| N=5
| O=8
| Appearance =
| Density =
| MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility =
| SolubleOther =
| Solvent =
| pKa =
| pKb =
| IsoelectricPt =
| LambdaMax =
| Absorbance =
| SpecRotation =
| RefractIndex =
| Viscosity =
| Dipole = }}
|Section3={{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape =
| Dipole = }}
|Section4={{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
|Section5={{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_US = }}
|Section6={{Chembox Explosive
| ShockSens =
| FrictionSens =
| DetonationV =
| REFactor = }}
|Section7={{Chembox Hazards
| ExternalSDS =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL = }}
|Section8={{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunction =
| OtherFunction_label =
| OtherCompounds = }}
}}
Isodesmosine is a lysine derivative found in elastin. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by lysyl-oxidase. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.{{cite journal | doi = 10.1016/j.matbio.2006.09.011 | pmid = 17112714 | title = Differential expression of two tropoelastin genes in zebrafish | journal = Matrix Biology | volume = 26 | issue = 2 | pages = 115–124 | year = 2007 | last1 = Miao | first1 = M. | last2 = Bruce | first2 = A.E.E. | last3 = Bhanji | first3 = T. | last4 = Davis | first4 = E.C. | last5 = Keeley | first5 = F.W. }}