isoferulic acid
{{chembox
| ImageFile = Isoferulic acid.svg
| IUPACName = (E)-3-(3-Hydroxy-4-methoxyphenyl)prop-2-enoic acid
| OtherNames = Hesperetic acid
3-(3-Hydroxy-4-methoxyphenyl)acrylic acid
Hesperetate
Isoferulate
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref =
| ChemSpiderID = 643318
| InChI = 1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+
| InChIKey = QURCVMIEKCOAJU-HWKANZROSA-N
| StdInChI_Ref =
| StdInChI =
| StdInChIKey_Ref =
| StdInChIKey =
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 537-73-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = XSQ2K2G7MC
| ChEMBL_Ref =
| ChEMBL =
| PubChem = 736186
| DrugBank_Ref =
| DrugBank =
| ChEBI_Ref =
| ChEBI = 27794
| SMILES = COC1=C(C=C(C=C1)C=CC(=O)O)O
}}
|Section2={{Chembox Properties
| C=10 | H=10 | O=4
| Appearance =
| Density =
| MeltingPtC =
| MeltingPt_notes =
| BoilingPt =
| pKa =
| Solubility =
}}
|Section3={{Chembox Hazards
| NFPA-H =
| NFPA-F =
| NFPA-R =
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Isoferulic acid is a hydroxycinnamic acid, a type of organic compound. It is an isomer of ferulic acid.
Occurrence in nature
Isoferulic acid can be found, amongst other compounds, in Lobelia chinensis.{{cite journal |vauthors=Chen JX, Huang SH, Wang Y, Shao M, Ye WC | title = Studies on the chemical constituents from Lobelia chinensis | year = 2010 | volume = 33 | issue = 11 | pmid = 21434431 | journal = Zhong Yao Cai | pages = 1721–4 }}
= In food =
Ferulic acid is found in pineapple flesh.{{cite journal | title = Phenolic profiles of pineapple fruits (Ananas comosus L. Merrill) Influence of the origin of suckers | author = Edwige Sopie Yapo, Hilaire Tanoh Kouakou, Laurent kouakou kouakou, Justin Yatty Kouadio, Patrice Kouamé andjean-Michel Mérillon | journal = Australian Journal of Basic and Applied Sciences | date = 2011 | volume = 5 | issue = 6 | pages = 1372–1378 }}
References
{{reflist}}
{{Hydroxycinnamic acid}}