isoferulic acid

{{chembox

| ImageFile = Isoferulic acid.svg

| IUPACName = (E)-3-(3-Hydroxy-4-methoxyphenyl)prop-2-enoic acid

| OtherNames = Hesperetic acid
3-(3-Hydroxy-4-methoxyphenyl)acrylic acid
Hesperetate
Isoferulate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref =

| ChemSpiderID = 643318

| InChI = 1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+

| InChIKey = QURCVMIEKCOAJU-HWKANZROSA-N

| StdInChI_Ref =

| StdInChI =

| StdInChIKey_Ref =

| StdInChIKey =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 537-73-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XSQ2K2G7MC

| ChEMBL_Ref =

| ChEMBL =

| PubChem = 736186

| DrugBank_Ref =

| DrugBank =

| ChEBI_Ref =

| ChEBI = 27794

| SMILES = COC1=C(C=C(C=C1)C=CC(=O)O)O

}}

|Section2={{Chembox Properties

| C=10 | H=10 | O=4

| Appearance =

| Density =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| pKa =

| Solubility =

}}

|Section3={{Chembox Hazards

| NFPA-H =

| NFPA-F =

| NFPA-R =

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Isoferulic acid is a hydroxycinnamic acid, a type of organic compound. It is an isomer of ferulic acid.

Occurrence in nature

Isoferulic acid can be found, amongst other compounds, in Lobelia chinensis.{{cite journal |vauthors=Chen JX, Huang SH, Wang Y, Shao M, Ye WC | title = Studies on the chemical constituents from Lobelia chinensis | year = 2010 | volume = 33 | issue = 11 | pmid = 21434431 | journal = Zhong Yao Cai | pages = 1721–4 }}

= In food =

Ferulic acid is found in pineapple flesh.{{cite journal | title = Phenolic profiles of pineapple fruits (Ananas comosus L. Merrill) Influence of the origin of suckers | author = Edwige Sopie Yapo, Hilaire Tanoh Kouakou, Laurent kouakou kouakou, Justin Yatty Kouadio, Patrice Kouamé andjean-Michel Mérillon | journal = Australian Journal of Basic and Applied Sciences | date = 2011 | volume = 5 | issue = 6 | pages = 1372–1378 }}

References