itramin tosilate
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 2-aminoethyl nitrate; 4-methylbenzenesulfonic acid
| image = Itramin tosilate.svg
| width = 200
| tradename = Nilatil
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 13445-63-1
| ATC_prefix = C01
| ATC_suffix = DX01
| PubChem = 26000
| DrugBank = DBSALT002523
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W9H0R50KY0
| KEGG = D07157
| ChEBI = 136001
| ChEMBL = 2106780
| ChemSpiderID = 24219
| synonyms = Itramin tosylate
| C=9 | H=14 | N=2 | O=6 | S=1
| smiles = CC1=CC=C(C=C1)S(=O)(=O)O.C(CO[N+](=O)[O-])N
| StdInChI = 1S/C7H8O3S.C2H6N2O3/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-7-4(5)6/h2-5H,1H3,(H,8,9,10);1-3H2
| StdInChIKey = HPPBBWMYZVALRK-UHFFFAOYSA-N
}}
Itramin tosilate (INN), or itramin tosylate (more commonly), is a vasodilator.{{cite journal | vauthors = Batterman RC, Mouratoff GJ | title = Anginal syndrome. Treatment with a long-acting nitrate (itramin tosylate) | journal = California Medicine | volume = 98 | pages = 318–9 | date = June 1963 | issue = 6 | pmid = 13966844 | pmc = 1575756 }}{{cite journal | vauthors = McGrath JC | title = 2-Aminoethylnitrate: Earlier investigation as a drug was missed by recent authors due to changes in nomenclature | journal = British Journal of Pharmacology | volume = 169 | issue = 4 | pages = 949–50 | date = June 2013 | pmid = 23711023 | pmc = 3687673 | doi = 10.1111/bph.12148 }}{{cite journal | vauthors = Ehrenberger W | title = [On the effects of 2-aminoethylnitrate p-toluenesulfonate (Nilatil) on coronary circulation disorders] | journal = Wiener Zeitschrift für Innere Medizin und Ihre Grenzgebiete | volume = 41 | pages = 323–4 | date = August 1960 | pmid = 13725976 }}{{cite journal | vauthors = Fremont RE | title = Clinical and cardiographic evaluation of a new nitrate, itramin tosylate | journal = Current Therapeutic Research, Clinical and Experimental | volume = 9 | issue = 5 | pages = 235–46 | date = May 1967 | pmid = 4963057 }}{{cite journal | vauthors = Kinnard WJ, Vogin EE, Aceto MD, Buckley JP | title = The Coronary Vasodilatory Effects of 2-Aminoethlynitrate p-Toluenesulfonate | journal = Angiology | volume = 15 | issue = 7 | pages = 312–5 | date = July 1964 | pmid = 14177999 | doi = 10.1177/000331976401500703 | s2cid = 29870356 }}{{cite journal | vauthors = Takenaka F, Umeda T | title = Effects of propranolo, itramin tosylate and dipyridamole on myocardial phosphate metabolism in anoxic perfused rat hearts | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 222 | issue = 1 | pages = 45–54 | date = July 1976 | pmid = 10860 }}
References
{{Reflist|2}}
{{Vasodilators used in cardiac diseases}}
{{Nitric oxide signaling}}
{{cardiovascular-drug-stub}}