laminaribiose

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477168953

| ImageFile = Laminaribiose.png

| ImageSize = 200px

| IUPACName = 3-β-{{small|D}}-Glucopyranosyl-(1→3)-{{small|D}}-glucose

| SystematicName = (2R,3S,4R,5R)-2,4,5,6-Tetrahydroxy-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal

| OtherNames = 3-β-{{small|D}}-Glucosyl-{{small|D}}-glucose

|Section1={{Chembox Identifiers

| PubChem = 439637

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 388710

| SMILES = O([C@H]1[C@H](O)[C@H](OC(O)[C@@H]1O)CO)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8-,9-,10+,11?,12+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QIGJYVCQYDKYDW-LCOYTZNXSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 34980-39-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0WN3D69UW4

}}

|Section2={{Chembox Properties

| Formula=C₁₂H₂₂O₁₁

| MolarMass=342.30 g/mol

| Appearance=

| Density=1.768 g/mL

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Laminaribiose C₁₂H₂₂O₁₁ is a disaccharide which is used notably in the agricultural field and as an antiseptic. It is in general obtained by hydrolysis or by acetolysis of natural polysaccharides of plant origin.{{cite patent| number=6632940|country=US}} It is also a product of the caramelization of glucose.{{Cite journal|doi =10.1111/j.1365-2621.1966.tb01905.x|title =The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose|year =1966|last1 =Sugisawa|first1 =Hirqshi|last2 =Edo|first2 =Hiroshi|journal =Journal of Food Science|volume =31|issue =4|pages =561}}