lancotrione

{{Short description|Weed control herbicide}}

{{Chembox

| Reference =

| ImageFile = Lancotrione.svg

| PIN = 2-[2-chloro-3-[2-(1,3-dioxolan-2-yl)ethoxy]-4-methylsulfonylbenzoyl]cyclohexane-1,3-dione

| OtherNames = {{ubl|||}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 1486617-21-3

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 9786774

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI =

| StdInChI=1S/C19H21ClO8S/c1-29(24,25)14-6-5-11(18(23)16-12(21)3-2-4-13(16)22)17(20)19(14)28-8-7-15-26-9-10-27-15/h5-6,15,21H,2-4,7-10H2,1H3

| StdInChIKey = YYRPFCKCSGLKJS-UHFFFAOYSA-N

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL =

| DrugBank =

| EC_number =

| PubChem = 11612020

| UNII = KMQ9P5LG22

| UNNumber =

| SMILES = CS(=O)(=O)C1=C(C(=C(C=C1)C(=O)C2C(=O)CCCC2=O)Cl)OCCC3OCCO3

}}

|Section2={{Chembox Properties

| C=19|H=21|Cl=1|O=8|S=1

| Appearance =

| Odour =

| Density =1.47{{cite web |title=Lancotrione sodium |url=https://direct.hpc-j.co.jp/sds/eng/NC-14_EN.pdf |publisher=Hayashi Pure Chemical Ind.,Ltd}}

| MeltingPtC =

| MeltingPt_notes =

| BoilingPtF =

| BoilingPt_notes =

| Solubility =

| Solvent1 = acetone

| Solubility1 =

| VaporPressure =

}}

|Section3={{Chembox Hazards

| MainHazards =

| HPhrases = {{HPhrases|}}

| GHS_ref=

| GHSPictograms =

| GHSSignalWord =

| PPhrases =

| LD50 = {{ubl||}}

| LC50 = {{ubl|}}

| FlashPtC =

| AutoignitionPtF =

}}

}}

Lancotrione is a herbicide, closely related to tefuryltrione. Its mode of action inhibits 4-hydroxyphenylpyruvate dioxygenase (HPPD), an enzyme which produces homogentisic acid.

It was announced by Ishihara Sangyo Kaisha in 2016,{{cite journal |last1=Jeanmart |first1=Stephane |last2=Edmunds |first2=Andrew J.F. |last3=Lamberth |first3=Clemens |last4=Pouliot |first4=Martin |last5=Morris |first5=James A. |title=Synthetic approaches to the 2015–2018 new agrochemicals |journal=Bioorganic & Medicinal Chemistry |date=June 2021 |volume=39 |pages=116162 |doi=10.1016/j.bmc.2021.116162|pmid=33895705 }} and commercialised in 2019.{{cite web |title=Lancotrione: mode of action, uses, and synthesis method_Chemicalbook |url=https://www.chemicalbook.com/article/lancotrione-mode-of-action-uses-and-synthesis-method.htm |website=www.chemicalbook.com}} Lancotrione is a new herbicide, usually used in the form of sodium salt to control grass weeds, in rice crops.{{cite journal |last1=Lewis |first1=Kathleen A. |last2=Tzilivakis |first2=John |last3=Warner |first3=Douglas J. |last4=Green |first4=Andrew |title=An international database for pesticide risk assessments and management |journal=Human and Ecological Risk Assessment |date=18 May 2016 |volume=22 |issue=4 |pages=1050–1064 |doi=10.1080/10807039.2015.1133242|bibcode=2016HERA...22.1050L |hdl=2299/17565 |hdl-access=free }} As such, little is yet known about it.