lanepitant

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(2R)-1-[Acetyl-[(2-methoxyphenyl)methyl]
amino]-3-(1H-indol-3-yl)propan-2-yl]-2-(4-piperidin-1-ylpiperidin-1-yl)acetamide

| image = Lanepitant.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| IUPHAR_ligand =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 170566-84-4

| CAS_supplemental =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 3086681

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 17G8FN2E1F

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 42407

| ChemSpiderID = 2343246

| C=33 | H=45 | N=5 | O=3

| smiles = CC(=O)N(CC1=CC=CC=C1OC)C[C@@H](CC2=CNC3=CC=CC=C32)NC(=O)CN4CCC(CC4)N5CCCCC5

| StdInChI = 1S/C33H45N5O3/c1-25(39)38(22-26-10-4-7-13-32(26)41-2)23-28(20-27-21-34-31-12-6-5-11-30(27)31)35-33(40)24-36-18-14-29(15-19-36)37-16-8-3-9-17-37/h4-7,10-13,21,28-29,34H,3,8-9,14-20,22-24H2,1-2H3,(H,35,40)/t28-/m1/s1

| StdInChIKey = CVXJAPZTZWLRBP-MUUNZHRXSA-N

| synonyms = LY303870; N-[(R)-2-Indol-3-yl-1-[[N-(o-methoxybenzyl)acetamido]methyl]ethyl][1,4'-bipiperidine]-1'-acetamide

}}

Lanepitant (INN,{{cite web | title = International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names (Rec. INN): List 39 | url =https://www.who.int/medicines/publications/druginformation/innlists/RL39.pdf | publisher = World Health Organization | accessdate = 17 November 2016 | date = 1998}}{{rp|48}} code name LY303870), developed by Eli Lilly, is a drug which acts as a selective antagonist of the NK1 receptor, and was one of the first compounds developed that act at this target.{{cite journal | vauthors = Gitter BD, Bruns RF, Howbert JJ, Waters DC, Threlkeld PG, Cox LM, Nixon JA, Lobb KL, Mason NR, Stengel PW | display-authors = 6 | title = Pharmacological characterization of LY303870: a novel, potent and selective nonpeptide substance P (neurokinin-1) receptor antagonist | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 275 | issue = 2 | pages = 737–44 | date = November 1995 | pmid = 7473161 }} It was under development as a potential analgesic drug, but despite promising results in initial animal studies, human clinical trials against migraine, arthritis and diabetic neuropathy all failed to show sufficient efficacy to support further development, with the drug being only marginally more effective than placebo and inferior to older comparison drugs such as naproxen.{{cite journal | vauthors = Goldstein DJ, Offen WW, Klein EG, Phebus LA, Hipskind P, Johnson KW, Ryan RE | title = Lanepitant, an NK-1 antagonist, in migraine prevention | journal = Cephalalgia | volume = 21 | issue = 2 | pages = 102–6 | date = March 2001 | pmid = 11422091 | doi = 10.1046/j.1468-2982.2001.00161.x | s2cid = 27388670 | doi-access = free }}{{cite journal | vauthors = Goldstein DJ, Wang O, Todd LE, Gitter BD, DeBrota DJ, Iyengar S | title = Study of the analgesic effect of lanepitant in patients with osteoarthritis pain | journal = Clinical Pharmacology and Therapeutics | volume = 67 | issue = 4 | pages = 419–26 | date = April 2000 | pmid = 10801252 | doi = 10.1067/mcp.2000.105243 | s2cid = 31571009 }}{{cite journal | vauthors = Goldstein DJ, Wang O, Gitter BD, Iyengar S | title = Dose-response study of the analgesic effect of lanepitant in patients with painful diabetic neuropathy | journal = Clinical Neuropharmacology | volume = 24 | issue = 1 | pages = 16–22 | pmid = 11290877 | doi = 10.1097/00002826-200101000-00004 | year = 2001 | s2cid = 46162128 }} Failure of analgesic action was thought to be due to poor penetration of the blood–brain barrier in humans, but research has continued into potential applications in the treatment of other disorders with a peripheral site of action, such as corneal neovascularization.{{cite journal | vauthors = Bignami F, Giacomini C, Lorusso A, Aramini A, Rama P, Ferrari G | title = NK1 receptor antagonists as a new treatment for corneal neovascularization | journal = Investigative Ophthalmology & Visual Science | volume = 55 | issue = 10 | pages = 6783–94 | date = September 2014 | pmid = 25228541 | doi = 10.1167/iovs.14-14553 | doi-access = free }}

References

{{Reflist}}

{{Neurokinin receptor modulators}}

Category:NK1 receptor antagonists

Category:Peripherally selective drugs

Category:2-Methoxyphenyl compounds

{{nervous-system-drug-stub}}