lasinavir
{{chembox
| Verifiedfields = changed
| verifiedrevid =
| ImageFile = Lasinavir.svg
| ImageSize = 200
| SystematicName = tert-Butyl (3S,4S,6R,9S)-13-benzyl-12-hydroxy-6,9-dioxo-7-(propan-2-yl)-10-[(2,3,4-trimethoxyphenyl)methyl]-2-oxa-5,8,14-triazapentadecan-15-oate
| OtherNames =
| Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 408297
| InChI = 1S/C35H53N3O9/c1-22(2)29(33(41)36-17-18-43-6)38-32(40)25(20-24-15-16-28(44-7)31(46-9)30(24)45-8)21-27(39)26(19-23-13-11-10-12-14-23)37-34(42)47-35(3,4)5/h10-16,22,25-27,29,39H,17-21H2,1-9H3,(H,36,41)(H,37,42)(H,38,40)/t25-,26+,27+,29+/m1/s1
| InChIKey = BEUUJDAEPJZWHM-COROXYKFSA-N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0QGV8237I3
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 175385-62-3
| PubChem = 464372
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| SMILES = CC(C)[C@@H](C(=O)NCCOC)NC(=O)[C@H](CC1=C(C(=C(C=C1)OC)OC)OC)C[C@@H]([C@H](CC2=CC=CC=C2)NC(=O)OC(C)(C)C)O
}}
|Section2={{Chembox Properties
| Formula = C35H53N3O9
| MolarMass = 659.81 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Lasinavir (INN,{{cite journal|title=International Nonproprietary Names for Pharmaceutical Substances (INN). RECOMMENDED International Nonproprietary Names (Rec. INN): List 38|journal=WHO Drug Information|date=1997|volume=11|issue=3|page=170|url=https://www.who.int/medicines/publications/druginformation/innlists/RL38.pdf?ua=1|accessdate=25 November 2015|publisher=World Health Organization}} previously known as BMS-234475 and CGP-61755) is an experimental peptidomimetic protease inhibitor researched by Novartis and Bristol-Myers Squibb as a treatment for HIV infection. It was originally discovered by Novartis at Basel (Switzerland).
{{US patent reference
| number = 7348345 B2
| y = 2008
| m = 08
| d = 02
| inventor = James Patrick Dunn, Steven Swallow, Zachary Kevin Sweeney
| title = Nonnucleoside reverse transcriptase inhibitors
}}
Its investigation was terminated after Phase I on October 09, 2002.{{cite web|title=Drug Profile: Lasinavir|url=http://adisinsight.springer.com/drugs/800006772|website=AdisInsight|publisher=Adis International Ltd, part of Springer Science+Business Media|accessdate=25 November 2015}}