lergotrile

{{short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-[(6aR,9S,10aR)-5-chloro-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetonitrile

| image = Lergotrile_structure.png

| width = 220px

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_US_comment =

| routes_of_administration =

| CAS_number = 36945-03-6

| CAS_number_Ref = {{cascite|correct|CAS}}

| ChEMBL = 80937

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O68JXU1W09

| KEGG = D04693

| PubChem = 6918447

| ChemSpiderID = 5293644

| synonyms = LY-79907; 2-Chloro-6-methylergoline-8β-acetonitrile

| C=17 | H=18 | Cl=1 | N=3

| SMILES = CN1C[C@@H](C[C@H]2[C@H]1CC3=C(NC4=CC=CC2=C34)Cl)CC#N

| StdInChI = 1S/C17H18ClN3/c1-21-9-10(5-6-19)7-12-11-3-2-4-14-16(11)13(8-15(12)21)17(18)20-14/h2-4,10,12,15,20H,5,7-9H2,1H3/t10-,12-,15-/m1/s1

| StdInChIKey = JKAHWGPTNVUTNB-IXPVHAAZSA-N

}}

Lergotrile ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|USAN|United States Adopted Name}}) is an ergoline derivative which acts as a dopamine receptor agonist. It was developed for the treatment of Parkinson's disease, but failed in clinical trials due to liver toxicity.{{cite journal | vauthors = Lieberman AN, Gopinathan G, Estey E, Kupersmith M, Goodgold A, Goldstein M | title = Lergotrile in Parkinson disease: further studies | journal = Neurology | volume = 29 | issue = 2 | pages = 267–72 | date = February 1979 | pmid = 34808 | doi = 10.1212/wnl.29.2.267 }}{{cite journal | vauthors = Cunningham KA, Callahan PM, Appel JB | title = Discriminative stimulus properties of lergotrile | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 230 | issue = 1 | pages = 47–52 | date = July 1984 | pmid = 6146709 }}