leteprinim

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| verifiedrevid = 444252852

| IUPAC_name = 4-{[3-(6-oxo-3,6-dihydro-9H-purin-9-yl)propanoyl]amino}benzoic acid

| image = Leteprinim.png

| width = 240

| tradename =

| routes_of_administration =

| elimination_half-life =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 138117-50-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 132123

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NBY3IU407M

| C=15 | H=13 | N=5 | O=4

| smiles = C1=CC(=CC=C1C(=O)O)NC(=O)CCN2C=NC3=C2NC=NC3=O

| ChemSpiderID = 116710

| StdInChI = 1S/C15H13N5O4/c21-11(19-10-3-1-9(2-4-10)15(23)24)5-6-20-8-18-12-13(20)16-7-17-14(12)22/h1-4,7-8H,5-6H2,(H,19,21)(H,23,24)(H,16,17,22)

| StdInChIKey = JMPOIZCOJJMTHI-UHFFFAOYSA-N

}}

Leteprinim (Neotrofin, AIT-082) is a hypoxanthine derivative drug with neuroprotective and nootropic effects.{{cite journal | vauthors = Di Iorio P, Virgilio A, Giuliani P, Ballerini P, Vianale G, Middlemiss PJ, Rathbone MP, Ciccarelli R | s2cid = 43094767 | title = AIT-082 is neuroprotective against kainate-induced neuronal injury in rats | journal = Experimental Neurology | volume = 169 | issue = 2 | pages = 392–9 | date = June 2001 | pmid = 11358452 | doi = 10.1006/exnr.2001.7654 }}{{cite journal | vauthors = Lahiri DK, Ge YW, Farlow MR | title = Effect of a memory-enhancing drug, AIT-082, on the level of synaptophysin | journal = Annals of the New York Academy of Sciences | volume = 903 | issue = 1 | pages = 387–93 | date = April 2000 | pmid = 10818529 | doi = 10.1111/j.1749-6632.2000.tb06390.x | bibcode = 2000NYASA.903..387L | s2cid = 33710679 }}{{cite journal | vauthors = Yan R, Nguyen Q, Gonzaga J, Johnson M, Ritzmann RF, Taylor EM | s2cid = 25028981 | title = Reversal of cycloheximide-induced memory disruption by AIT-082 (Neotrofin) is modulated by, but not dependent on, adrenal hormones | journal = Psychopharmacology | volume = 166 | issue = 4 | pages = 400–7 | date = April 2003 | pmid = 12605287 | doi = 10.1007/s00213-002-1350-5 }} It stimulates release of nerve growth factors and enhances survival of neurons in the brain,{{cite journal | vauthors = Rathbone MP, Middlemiss PJ, Crocker CE, Glasky MS, Juurlink BH, Ramirez JJ, Ciccarelli R, Di Iorio P, Caciagli F | title = AIT-082 as a potential neuroprotective and regenerative agent in stroke and central nervous system injury | journal = Expert Opinion on Investigational Drugs | volume = 8 | issue = 8 | pages = 1255–62 | date = August 1999 | pmid = 15992149 | doi = 10.1517/13543784.8.8.1255 }}{{cite journal | vauthors = Ramirez JJ, Parakh T, George MN, Freeman L, Thomas AA, White CC, Becton A | title = The effects of Neotrofin on septodentate sprouting after unilateral entorhinal cortex lesions in rats | journal = Restorative Neurology and Neuroscience | volume = 20 | issue = 1–2 | pages = 51–9 | year = 2002 | pmid = 12237496 }}{{cite journal | vauthors = Holmes M, Maysinger D, Foerster A, Pertens E, Barlas C, Diamond J | title = Neotrofin, a novel purine that induces NGF-dependent nociceptive nerve sprouting but not hyperalgesia in adult rat skin | journal = Molecular and Cellular Neurosciences | volume = 24 | issue = 3 | pages = 568–80 | date = November 2003 | pmid = 14664808 | doi = 10.1016/s1044-7431(03)00217-3 | s2cid = 13359687 }}{{cite journal | vauthors = Jiang S, Khan MI, Middlemiss PJ, Lu Y, Werstiuk ES, Crocker CE, Ciccarelli R, Caciagli F, Rathbone MP | title = AIT-082 and methylprednisolone singly, but not in combination, enhance functional and histological improvement after acute spinal cord injury in rats | journal = International Journal of Immunopathology and Pharmacology | volume = 17 | issue = 3 | pages = 353–66 | year = 2004 | pmid = 15461869 | doi = 10.1177/039463200401700315 | doi-access = | s2cid = 26045848 }}{{cite journal | vauthors = Calcutt NA, Freshwater JD, Hauptmann N, Taylor EM, Mizisin AP | title = Protection of sensory function in diabetic rats by Neotrofin | journal = European Journal of Pharmacology | volume = 534 | issue = 1–3 | pages = 187–93 | date = March 2006 | pmid = 16507305 | doi = 10.1016/j.ejphar.2006.01.047 }} and is under development as a potential treatment for neurodegenerative disorders such as Alzheimer's disease, Parkinson's disease and stroke.{{cite journal | vauthors = Potkin SG, Alva G, Keator D, Carreon D, Fleming K, Fallon JH | title = Brain metabolic effects of Neotrofin in patients with Alzheimer's disease | journal = Brain Research | volume = 951 | issue = 1 | pages = 87–95 | date = September 2002 | pmid = 12231461 | doi = 10.1016/s0006-8993(02)03140-2 | s2cid = 23021393 }}{{cite journal | vauthors = Johnston TH, Brotchie JM | title = Drugs in development for Parkinson's disease | journal = Current Opinion in Investigational Drugs | volume = 5 | issue = 7 | pages = 720–6 | date = July 2004 | pmid = 15298067 }}