leucodelphinidin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424867807

| Name = Leucodelphinidin

| ImageFile = Leucodelphinidin.svg

| ImageSize = 250px

| IUPACName = (2R,3S,4S)-Flavan-3,3′,4,4′,5,5′,7-heptol

| SystematicName = (2R,3S,4S)-2-(3,4,5-Trihydroxyphenyl)-2H-1-benzopyran-3,4,5,7-tetrol

| OtherNames = leukoefdin
Leucoefdin
leucodelfinidin
Leucoephdine
Leukoephdin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 12764-74-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7Y16CK877U

| PubChem = 440835

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 6417

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 389679

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C05909

| SMILES = C1=C(C=C(C(=C1O)O)O)C2C(C(C3=C(C=C(C=C3O2)O)O)O)O

| InChI = 1/C15H14O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,13-22H/t13-,14-,15+/m0/s1

| InChIKey = ZEACOKJOQLAYTD-SOUVJXGZBJ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H14O8/c16-6-3-7(17)11-10(4-6)23-15(14(22)13(11)21)5-1-8(18)12(20)9(19)2-5/h1-4,13-22H/t13-,14-,15+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = ZEACOKJOQLAYTD-SOUVJXGZSA-N

}}

|Section2={{Chembox Properties

| Formula = C₁₅H₁₄O₈

| MolarMass = 322.26 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Leucodelphinidin is a colorless chemical compound related to leucoanthocyanidins. It can be found in Acacia auriculiformis,{{Cite journal |pmc=1264869 |date=1966 |last1=Drewes |first1=S. E. |last2=Roux |first2=D. G. |title=A new flavan-3,4-diol from Acacia auriculiformis by paper ionophoresis |journal=Biochemical Journal |volume=98 |issue=2 |pages=493–500 |doi=10.1042/bj0980493 |pmid=5941342 }} in the bark of Karada (Cleistanthus collinus) and in the kino (gum) from Eucalyptus pilularis.{{cite journal | url=https://dx.doi.org/10.1016/0040-4020%2858%2980017-4 | doi=10.1016/0040-4020(58)80017-4 | title=A study of leucoanthocyanidins of plants—I | date=1958 | last1=Ganguly | first1=A.K. | last2=Seshadri | first2=T.R. | last3=Subramanian | first3=P. | journal=Tetrahedron | volume=3 | issue=3 | pages=225–229 | url-access=subscription }}

Other species containing leucodelphinidin include Aesculus hippocastanum (Horse chestnut, in rind/bark/cortex), Arachis hypogaea (Earth nut in seeds), Arbutus unedo (Arbutus, in the leaf), Caesalpinia pulcherrima (Barbados pride), Ceratonia siliqua (Carob, in the fruit), Hamamelis virginiana (American witch hazel, in the leaf), Hippophae rhamnoides (Hippophae berry, in the leaf), Humulus lupulus (bine flower / blossom, in the leaf), Musa acuminata × balbisiana (Banana, in the fruit), Nelumbo nucifera (lotus, in the leaf), Phyllanthus emblica (Emblic, Indian gooseberry, in the rind/bark/cortex), Quercus alba (White oak, in the rind/bark/cortex), Quercus robur (Common oak, in the rind/bark/cortex), Rumex hymenosepalus (Arizona dock, in the root), Schinus molle (California peppertree, in the leaf) and Vicia faba (bell-bean, in the seed).[http://www.liberherbarum.com/Minor/UK/IN1764.htm Leucodelphinidin on liberherbarum.com]

A leucodelphinidin derivative isolated from Ficus bengalensis shows hypoglycemic effects.{{cite journal | url=https://pubmed.ncbi.nlm.nih.gov/7814088/ | pmid=7814088 | date=1994 | last1=Geetha | first1=B. S. | last2=Mathew | first2=B. C. | last3=Augusti | first3=K. T. | title=Hypoglycemic effects of leucodelphinidin derivative isolated from Ficus bengalensis (Linn) | journal=Indian Journal of Physiology and Pharmacology | volume=38 | issue=3 | pages=220–222 }}