levdobutamine

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Levdobutamine.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Sympathomimetic; β₁-Adrenergic receptor agonist; Positive inotrope

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 61661-06-1

| CAS_supplemental =

| PubChem = 688441

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 599903

| UNII = 0PE6UXH3WG

| KEGG =

| ChEBI = 59805

| ChEMBL = 1367478

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Levodobutamine; (S)-Dobutamine; LY-206243

| IUPAC_name = 4-[2-[[(2S)-4-(4-hydroxyphenyl)butan-2-yl]amino]ethyl]benzene-1,2-diol

| C=18 | H=23 | N=1 | O=3

| SMILES = C[C@@H](CCC1=CC=C(C=C1)O)NCCC2=CC(=C(C=C2)O)O

| StdInChI = 1S/C18H23NO3/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h4-9,12-13,19-22H,2-3,10-11H2,1H3/t13-/m0/s1

| StdInChIKey = JRWZLRBJNMZMFE-ZDUSSCGKSA-N

}}

Levdobutamine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name LY-206243; also known as (S)-dobutamine) is a sympathomimetic, selective β₁-adrenergic receptor agonist, and positive inotrope which was never marketed.{{cite book | vauthors = Morton IK, Hall JM | title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms | publisher=Springer Netherlands | year=2012 | isbn=978-94-011-4439-1 | url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA164 | access-date=27 February 2025 | page=164}}{{cite book | vauthors = Milne G, Zeman E | title=Ashgate Handbook of Cardiovascular Agents: An International Guide to 1900 Drugs in Current Use: An International Guide to 1900 Drugs in Current Use | publisher=Taylor & Francis | series=Routledge Revivals | year=2017 | isbn=978-1-351-74240-5 | url=https://books.google.com/books?id=ZlkPEAAAQBAJ&pg=PA228 | access-date=27 February 2025 | page=228}} It is the (S)-enantiomer of dobutamine.