levobetaxolol
{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 462090629
| IUPAC_name = (S)-1-[p-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(isopropylamino)-2-propanol hydrochloride
| image = levobetaxolol_structure.svg
| image2 = levobetaxolol-fill.png
| tradename =
| Drugs.com = {{drugs.com|CONS|levobetaxolol}}
| pregnancy_AU =
| pregnancy_US = C
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = topical (ophthalmic)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life = 20 hours
| excretion =
| IUPHAR_ligand = 8035
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 93221-48-8
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 60657
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 54669
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 75O9XHA4TU
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 59254
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201274
| C=18 | H=29 | N=1 | O=3
| smiles = O(CCc1ccc(OC[C@@H](O)CNC(C)C)cc1)CC2CC2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3/t17-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NWIUTZDMDHAVTP-KRWDZBQOSA-N
}}
Levobetaxolol is a drug used to lower the pressure in the eye in treating conditions such as glaucoma. It is marketed as a 0.25 or 0.5% ophthalmic solution of levobetaxolol hydrochloride under the trade name Betaxon. Levobetaxolol is a beta-adrenergic receptor inhibitor (beta blocker).
Indications
It is indicated for intraocular pressure reduction in patients with open-angle glaucoma or ocular hypertension.{{cite journal | vauthors = Quaranta L, Turano R, Pizzolante T | title = Levobetaxolol hydrochloride: a review of its pharmacology and use in the treatment of chronic open-angle glaucoma and ocular hypertension | journal = Clinical Ophthalmology | volume = 1 | issue = 2 | pages = 93–7 | date = June 2007 | pmid = 19668496 | pmc = 2704505 }}
Effect
Levobetaxolol inhibits the beta-1-adrenergic receptor. When applied topically, it reduces intra-ocular pressure (IOP) by 16-23% depending on time of day and the individual. It also has neuroprotective effects. Levobetaxolol has fewer cardiovascular side effects than other beta blockers.
Contraindications and side effects
Levobetaxolol should not be used by people who have sinus bradycardia, atrioventricular block, cardiogenic shock, or overt cardiac failure. The drug has been associated with bradycardia and hypertension.{{cn|date=April 2019}}
History
References
{{reflist}}
{{Beta blockers}}
{{Antiglaucoma preparations and miotics}}
Category:N-isopropyl-phenoxypropanolamines